Name |
Oleanolic acid Astrantiagenin C Virgaureagenin B 3beta-Hydroxyolean-12-en-28-oic acid |
Formula |
C30H48O3 |
Mw |
456.3603454 |
CAS RN |
508-02-1 |
C_ID |
C00019064
,
|
InChIKey |
MIJYXULNPSFWEK-GYQWOJAJNA-N |
InChICode |
InChI=1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23+,27+,28-,29-,30+/m1/s1 |
SMILES |
C1[C@@H](C([C@@H]2[C@](C1)([C@H]1[C@@](CC2)([C@]2(C(=CC1)[C@@H]1[C@@](CC2)(CCC(C1)(C)C)C(=O)O)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera nigra | Ref. |
Plantae | Acanthaceae | Blepharis sindica | Ref. |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Amaranthaceae | Achyranthes aspera | Ref. |
Plantae | Amaranthaceae | Achyranthes bidentata | Ref. |
Plantae | Anacardiaceae | Pistacia terebinthus L. | Ref. |
Plantae | Apiaceae | Astrantia major | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Apocynaceae | Nerium oleander | Ref. |
Plantae | Apocynaceae | Plumeria obtusa L. | Ref. |
Plantae | Aquifoliaceae | Ilex asprella | Ref. |
Plantae | Aquifoliaceae | Ilex pubescens | Ref. |
Plantae | Araliaceae | Acanthopanax senticosus | Ref. |
Plantae | Araliaceae | Acanthopanax sessiliflorus | Ref. |
Plantae | Araliaceae | Aralia chinensis | Ref. |
Plantae | Araliaceae | Aralia cordata | Ref. |
Plantae | Araliaceae | Aralia elata | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Baccharis heterophylla | Ref. |
Plantae | Asteraceae | Baccharis salicina | Ref. |
Plantae | Asteraceae | Baccharis sarothroides | Ref. |
Plantae | Asteraceae | Baccharis vaccinoides | Ref. |
Plantae | Asteraceae | Calendula officinalis | Ref. |
Plantae | Asteraceae | Centaurea cachanahuen | Ref. |
Plantae | Asteraceae | Helichrysum forskahlii | Ref. |
Plantae | Asteraceae | Inula cappa | Ref. |
Plantae | Asteraceae | Senecio burtonii | Ref. |
Plantae | Asteraceae | Viguiera decurrens | Ref. |
Plantae | Bignoniaceae | Campsis grandiflora | Ref. |
Plantae | Bignoniaceae | Newbouldia laevis | Ref. |
Plantae | Cactaceae | Stenocereus eruca | Ref. |
Plantae | Caprifoliaceae | Patrinia scabiosaefolia | Ref. |
Plantae | Caryophyllaceae | Gypsophila struthium | Ref. |
Plantae | Caryophyllales | Beta vulgaris | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Chrysobalanaceae | Couepia polyandra | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia polyantha | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia vilersiana | Ref. |
Plantae | Clusiaceae-Guttiferae | Symphonia globulifera Linn f. | Ref. |
Plantae | Combretaceae | Terminalia superba | Ref. |
Plantae | Convallariaceae | Liriope muscari | Ref. |
Plantae | Convallariaceae | Ophiopogon japonicus | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Cucurbitaceae | Momordica cochinchinensis | Ref. |
Plantae | Dipsacaceae | Cephalaria transsylvanica | Ref. |
Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Scabiosa soongorica | Ref. |
Plantae | Dipterocarpaceae | Dryobalanops aromatica | Ref. |
Plantae | Ebenaceae | Diospyros castanea | Ref. |
Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
Plantae | Ebenaceae | Diospyros curranii | Ref. |
Plantae | Ebenaceae | Diospyros evena | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ebenaceae | Diospyros malanonilau | Ref. |
Plantae | Ebenaceae | Diospyros melanoxylon | Ref. |
Plantae | Ebenaceae | Diospyros montana | Ref. |
Plantae | Ebenaceae | Diospyros moonii | Ref. |
Plantae | Ebenaceae | Diospyros oblongifolia | Ref. |
Plantae | Ebenaceae | Diospyros peregrina | Ref. |
Plantae | Ebenaceae | Diospyros tomentosa | Ref. |
Plantae | Ebenaceae | Diospyros zombensis | Ref. |
Plantae | Elaeagnaceae | Elaeagnus angustifolia | Ref. |
Plantae | Ericaceae | Enkianthus cernuus | Ref. |
Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
Plantae | Ericaceae | Pieris japonica D.Don. | Ref. |
Plantae | Ericaceae | Pyrola japonica | Ref. |
Plantae | Euphorbiaceae | Euphorbia paralias | Ref. |
Plantae | Euphorbiaceae | Neoboutonia glabrescens Prain | Ref. |
Plantae | Fabaceae | Albizzia lebbeck | Ref. |
Plantae | Fabaceae | Cassia siamea Lamk. | Ref. |
Plantae | Fabaceae | Erythrina indica | Ref. |
Plantae | Fabaceae | Erythrina senegalensis | Ref. |
Plantae | Fabaceae | Eysenhardtia platycarpa | Ref. |
Plantae | Fabaceae | Gleditsia sinensis | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago arborea | Ref. |
Plantae | Fabaceae | Medicago hybrida | Ref. |
Plantae | Fabaceae | Medicago polymorpha | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Prosopis glandulosa | Ref. |
Plantae | Fabaceae | Psorothamnus arborescens | Ref. |
Plantae | Gentianaceae | Gentiana loureirii | Ref. |
Plantae | Gentianaceae | Swertia mileensis | Ref. |
Plantae | Gentianaceae | Swertia mussotii | Ref. |
Plantae | Gentianaceae | Swertia randaiensis | Ref. |
Plantae | Gentianaceae | Tripterospermum taiwanense | Ref. |
Plantae | Icacinaceae | Gonocaryum calleryanum | Ref. |
Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
Plantae | Labiatae | Agastache rugosus | Ref. |
Plantae | Labiatae | Ballota limbata | Ref. |
Plantae | Labiatae | Callicarpa arborea | Ref. |
Plantae | Labiatae | Dracocephalum kotschyi | Ref. |
Plantae | Labiatae | Hyptis capitata | Ref. |
Plantae | Labiatae | Isodon japonica | Ref. |
Plantae | Labiatae | Isodon phyllostachys | Ref. |
Plantae | Labiatae | Lavandula canariensis | Ref. |
Plantae | Labiatae | Leucas cephalotes SPRENG. | Ref. |
Plantae | Labiatae | Marsypianthes chamaedrys | Ref. |
Plantae | Labiatae | Meriandra benghalensis | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum spicatum | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Orthosiphon stamineus | Ref. |
Plantae | Labiatae | Perilla frutescens (L.) Britton var.japonica Hara | Ref. |
Plantae | Labiatae | Prunella vulgaris | Ref. |
Plantae | Labiatae | Salvia amplexicaulis Lam. | Ref. |
Plantae | Labiatae | Salvia breviflora | Ref. |
Plantae | Labiatae | Salvia canariensis L. | Ref. |
Plantae | Labiatae | Salvia hydrangea | Ref. |
Plantae | Labiatae | Salvia nicolsoniana | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia syriaca L. | Ref. |
Plantae | Labiatae | Salvia virgata | Ref. |
Plantae | Labiatae | Satureja montana | Ref. |
Plantae | Labiatae | Satureja obovata | Ref. |
Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
Plantae | Labiatae | Sideritis discolor | Ref. |
Plantae | Labiatae | Sideritis lotsyi var. mascaensis | Ref. |
Plantae | Labiatae | Sideritis soluta | Ref. |
Plantae | Labiatae | Thymus caramanicus | Ref. |
Plantae | Labiatae | Thymus persicus | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Lamiaceae | Rabdosia rubescens | Ref. |
Plantae | Lardizabalaceae | Akebia quinata | Ref. |
Plantae | Lardizabalaceae | Stauntonia hexahylla | Ref. |
Plantae | Longaniaceae | Strychnos potatorum | Ref. |
Plantae | Loranthaceae | Loranthus falcatus | Ref. |
Plantae | Loranthaceae | Loranthus parasiticus | Ref. |
Plantae | Lythraceae | Punica granatum LINN. | Ref. |
Plantae | Malpighiaceae | Acridocarpus vivy | Ref. |
Plantae | Malvaceae | Helicteres angustifolia | Ref. |
Plantae | Malvaceae | Scaphopetalum thonneri | Ref. |
Plantae | Melastomataceae | Melastoma intermedium | Ref. |
Plantae | Meliaceae | Ekebergia capensis | Ref. |
Plantae | Melianthaceae | Bersama swinyi | Ref. |
Plantae | Moraceae | Broussonetia kazinoki | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis var.obtusa | Ref. |
Plantae | Myrtaceae | Eucalyptus occidentalis | Ref. |
Plantae | Myrtaceae | Syzygium aromatica | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Myrtaceae | Syzygium claviflorum | Ref. |
Plantae | Myrtaceae | Syzygium cumini | Ref. |
Plantae | Myrtaceae | Syzygium formosanum | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus pumilio | Ref. |
Plantae | Oleaceae | Forsythia suspensa | Ref. |
Plantae | Oleaceae | Ligustrum lucidum | Ref. |
Plantae | Oleaceae | Nyctanthes arbor-tristis Linn. | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Onagraceae | Ludwigia octovalvis | Ref. |
Plantae | Phyllanthaceae | Phyllanthus urinaria | Ref. |
Plantae | Phytolaccaceae | Phytolacca americana | Ref. |
Plantae | Plantaginaceae | Plantago asiatica | Ref. |
Plantae | Plantaginaceae | Plantago depressa | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Putranjivaceae | Drypetes inaequalis | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa | Ref. |
Plantae | Rhizophoraceae | Ceriops tagal | Ref. |
Plantae | Rosaceae | Chaenomeles japonica | Ref. |
Plantae | Rosaceae | Chaenomeles lagenaria | Ref. |
Plantae | Rosaceae | Chaenomeles sinensis | Ref. |
Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
Plantae | Rosaceae | Photinia serrulata | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Rosa multiflora | Ref. |
Plantae | Rosaceae | Rosa woodsii | Ref. |
Plantae | Rubiaceae | Chiococca alba | Ref. |
Plantae | Rubiaceae | Coussarea paniculata | Ref. |
Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
Plantae | Rubiaceae | Morinda citrifolia L. | Ref. |
Plantae | Rubiaceae | Oldenlandia diffusa | Ref. |
Plantae | Rubiaceae | Paederia scandens | Ref. |
Plantae | Rubiaceae | Rubia cordifolia L. | Ref. |
Plantae | Rutaceae | Oricia suaveolens | Ref. |
Plantae | Rutaceae | Oriciopsis glaberrima ENGL. | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Santalaceae | Viscum articulactum | Ref. |
Plantae | Santalaceae | Viscum articulatum | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Sapindaceae | Xanthoceras sorbifolia | Ref. |
Plantae | Saxifragaceae | Aceriphyllum rossii | Ref. |
Plantae | Stilbaceae | Nuxia sphaerocephala | Ref. |
Plantae | Symplocaceae | Symplocos racemosa | Ref. |
Plantae | Taxodiaceae | Taxodium lanceolata | Ref. |
Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense | Ref. |
Plantae | Ulmaceae | Ulmus pumila L. | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Centranthus longiflorus ssp. longiflorus | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
Plantae | Verbenaceae | Junellia tridens | Ref. |
Plantae | Verbenaceae | Verbena littoralis | Ref. |
Plantae | Verbenaceae | Verbena officinalis | Ref. |
- | - | Chamaenerion angustifolium | Ref. |
- | - | Clerodendranthus spicatus | Ref. |
- | - | Ficaria verna Hudson | Ref. |
- | - | Phoradendron juniperinum | Ref. |
- | - | Ternstromia gymnanthera | Ref. |
|
|
zoom in
Organism | Swertia mileensis | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Xiang, et al., Zhongguo Yaowu Huaxue Zazhi, 8, (1998), 44.
Wang, et al., ZYZ, 29, (1994), 268.
Zhang, et al., ZYZ, 29, (1994), 600.
Tang, et al., ZYZ, 31, (1996), 204.
Gui, et al., ZYZ, 32, (1997), 204.
Lei, et al., ZYZ, 32, (1997), 271.
Lu, et al., CCMM, 22, (1997), 680.
Zhou, et al., CCMM, 23, (1998), 164.
Xu, et al., CCMM, 23, (1998), 733.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Saeidnia, et al., Chem Pharm Bull, 52, (2004), 1249.
Chang, et al., JNP, 67, (2004), 91.
Makino, et al., Phytochemistry, 65, (2004), 891.
Calixto, et al., Planta Med, 69, (2003), 973.
Endo, et al., Tetrahedron, 36, (1980), 2449.
Mambu, et al., Phytochemistry, 67, (2006), 444.
Cheng, et al., JNP, 67, (2004), 1761.
Gu, et al., Planta Med, 70, (2004), 509.
Jin, et al., Planta Med, 70, (2004), 564.
Zhong, et al., Planta Med, 70, (2004), 797.
Lin, et al., Planta Med, 71, (2005), 171.
Lee, et al., Planta Med, 69, (2003), 327.
Chaturvedula, et al., Planta Med, 69, (2003), 440.
Scirafianpour, et al., Planta Med, 69, (2003), 846.
Lee, et al., Planta Med, 69, (2003), 1051.
Yoshimura, et al., Planta Med, 69, (2003), 673.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|