Name |
Cirsilineol Anisomelin Eupatrin Fastigenin 5,4'-Dihydroxy-6,7,3'-trimethoxyflavone |
Formula |
C18H16O7 |
Mw |
344.08960287 |
CAS RN |
41365-32-6 |
C_ID |
C00013595
,
|
InChIKey |
VKOSQMWSWLZQPA-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O7/c1-22-13-6-9(4-5-10(13)19)12-7-11(20)16-14(25-12)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1cc(c(cc1)O)OC)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia herba-alba | Ref. |
Plantae | Asteraceae | Artemisia oliveriana | Ref. |
Plantae | Asteraceae | Artemisia vestita | Ref. |
Plantae | Asteraceae | Blumea lacera | Ref. |
Plantae | Asteraceae | Centaurea macrocephala | Ref. |
Plantae | Asteraceae | Cirsium lineare | Ref. |
Plantae | Asteraceae | Heterotheca grandiflora | Ref. |
Plantae | Asteraceae | Oncosiphon grandiflorum | Ref. |
Plantae | Asteraceae | Palafoxia sphacelata | Ref. |
Plantae | Bignoniaceae | Tecomella undulata | Ref. |
Plantae | Bromeliaceae | Tillandsia utriculata | Ref. |
Plantae | Labiatae | Hyssopus officinalis | Ref. |
Plantae | Labiatae | Lycopus europaeus | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicum L. | Ref. |
Plantae | Labiatae | Ocimum spp. | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum L. | Ref. |
Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
Plantae | Labiatae | Origanum calcaratum | Ref. |
Plantae | Labiatae | Origanum dictamnus | Ref. |
Plantae | Labiatae | Origanum floribundum | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum microphyllum | Ref. |
Plantae | Labiatae | Origanum onites | Ref. |
Plantae | Labiatae | Origanum syriacum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Glandulosum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Hirtum | Ref. |
Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
Plantae | Labiatae | Salvia tomentosa | Ref. |
Plantae | Labiatae | Sideritis mugronensis | Ref. |
Plantae | Labiatae | Sideritis spp. | Ref. |
Plantae | Labiatae | Teucrium alyssifolium | Ref. |
Plantae | Labiatae | Teucrium marum | Ref. |
Plantae | Labiatae | Thymus herba-barona | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Labiatae | Ziziphora hispanica | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Verbenaceae | Lippia citriodora | Ref. |
|
|
zoom in
Organism | Cirsium lineare | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Morita,Phytochem.,12,(1973),421
Wollenweber,Phytochem.,24,(1985),2129 |
---|
|