Name |
3'-Methylorobol 3'-O-Methylorobol Orobol 3'-methyl ether |
Formula |
C16H12O6 |
Mw |
300.06338812 |
CAS RN |
36190-95-1 |
C_ID |
C00009458
,
|
InChIKey |
ZMFBGWWGXBNJAC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O6/c1-21-13-4-8(2-3-11(13)18)10-7-22-14-6-9(17)5-12(19)15(14)16(10)20/h2-7,17-19H,1H3 |
SMILES |
c1(cc(c2c(c1)occ(c2=O)c1cc(c(cc1)O)OC)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
Plantae | Asteraceae | Wyethia helenioides | Ref. |
Plantae | Asteraceae | Wyethia mollis | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Fabaceae | Cytisus scoparius | Ref. |
Plantae | Fabaceae | Dalbergia inundata | Ref. |
Plantae | Fabaceae | Dalbergia parviflora | Ref. |
Plantae | Fabaceae | Derris scandens | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Thermopsis spp. | Ref. |
Plantae | Moraceae | Cudrania cochinchinensis | Ref. |
- | - | Moghania philippinensis | Ref. |
|
|
zoom in
Organism | Dalbergia inundata | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Leite de Almeida,Phytochem.,13,(1974),751
Dement,Phytochem.,11,(1972),1089 |
---|
|