Name |
alpha-Tocopherol |
Formula |
C29H50O2 |
Mw |
430.38108084 |
CAS RN |
59-02-9 |
C_ID |
C00007366
,
|
InChIKey |
GVJHHUAWPYXKBD-BFRPKOEANA-N |
InChICode |
InChI=1S/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3/t21-,22-,29-/m1/s1 |
SMILES |
c1(c2c(c(c(c1O)C)C)O[C@@](CC2)(CCC[C@@H](CCC[C@@H](CCCC(C)C)C)C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Amaranthaceae | Amaranthus hypochondriacus L. | Ref. |
Plantae | Annonaceae | Uvaria pandensis | Ref. |
Plantae | Apiaceae | Carum carvi L. | Ref. |
Plantae | Apiaceae | Coriandrum sativum L. | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Foeniculum vulgare L. | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Bixaceae | Bixa orellana L. | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum L. | Ref. |
Plantae | Caryophyllaceae | Lychnis coronaria | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea | Ref. |
Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea var. italica | Ref. |
Plantae | Cruciferae | Brassica rapa | Ref. |
Plantae | Cucurbitaceae | Cucurbita sp. | Ref. |
Plantae | Dictyosphaeriaceae | Botryococcus braunii | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ericaceae | Vaccinium macrocarpon Aiton | Ref. |
Plantae | Euphorbiaceae | Hevea brasiliensis Mull.Arg. | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Juglandaceae | Juglans regia L. | Ref. |
Plantae | Labiatae | Rosmarinus officinalis L. | Ref. |
Plantae | Lauraceae | Machilus zuihoensis | Ref. |
Plantae | Malvaceae | Hibiscus syriacus | Ref. |
Plantae | Meliaceae | Xylocarpus granatum | Ref. |
Plantae | Myrtaceae | Feijoa sellowiana | Ref. |
Plantae | Palmae | Cocos nucifera L. | Ref. |
Plantae | Palmae | Elaeis guineensis Jacq. | Ref. |
Plantae | Pinaceae | Pinus koraiensis | Ref. |
Plantae | Poaceae | Avena sativa L. | Ref. |
Plantae | Poaceae | Hordeum vulgare L. | Ref. |
Plantae | Poaceae | Oryza sativa L. | Ref. |
Plantae | Poaceae | Secale cereale L. | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Poaceae | Zea mays L. | Ref. |
Plantae | Proteaceae | Gevuina avellana Mol. | Ref. |
Plantae | Ranunculaceae | Delphinium ajacis L. | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum Hort. | Ref. |
Plantae | Sapindaceae | Litchi chinensis Sonn. | Ref. |
Plantae | Sapotaceae | Sebertia acuminata | Ref. |
Plantae | Schisandraceae | Schisandra chinensis | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Nicotiana tabacum L. | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Vitaceae | Vitis vinifera L. | Ref. |
|
|
zoom in
Organism | Terminalia brasiliensis | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|