Name |
Primulin Malvidin 3-O-beta-D-galactopyranoside |
Formula |
C23H25O12 |
Mw |
493.13460127 |
CAS RN |
30113-37-2 |
C_ID |
C00006734
,
|
InChIKey |
PXUQTDZNOHRWLI-KPGBKAJINA-O |
InChICode |
InChI=1S/C23H24O12/c1-31-14-3-9(4-15(32-2)18(14)27)22-16(7-11-12(26)5-10(25)6-13(11)33-22)34-23-21(30)20(29)19(28)17(8-24)35-23/h3-7,17,19-21,23-24,28-30H,8H2,1-2H3,(H2-,25,26,27)/p+1/t17-,19-,20-,21+,23+/m0/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)CO)O)O)O)c1cc(c(c(c1)OC)O)OC)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Coriariaceae | Coriaria myrtifolia | Ref. |
Plantae | Ericaceae | Empetrum nigrum | Ref. |
Plantae | Ericaceae | Gaylussacia spp. | Ref. |
Plantae | Ericaceae | Vaccinium corymbosum | Ref. |
Plantae | Ericaceae | Vaccinium myrtillus L. | Ref. |
Plantae | Ericaceae | Vaccinium padifolium | Ref. |
Plantae | Ericaceae | Vaccinium spp. | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Myrsinaceae | Ardisia humilis | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Sapindaceae | Blighia sieboldii | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
Organism | Vaccinium spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Francis,J.Food Sci.,31,(1966),583
Ballinger,J.Am.Soc.Hortic.Sci.,95,(1970),283 |
---|
|