Name |
Petunidin 3-glucoside Petunidin 3-O-beta-D-glucopyranoside Petunidin-3-O-glucoside |
Formula |
C22H23O12.Cl |
Mw |
514.08780391 |
CAS RN |
6988-81-4 |
C_ID |
C00006722
,
|
InChIKey |
CCQDWIRWKWIUKK-ARDHMINRNA-O |
InChICode |
InChI=1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1cc(c(c(c1)OC)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Anacardiaceae | Cotinus coggygria | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Berberidaceae | Berberis buxifolia | Ref. |
Plantae | Berberidaceae | Berberis fortunei | Ref. |
Plantae | Ericaceae | Gaylussacia spp. | Ref. |
Plantae | Ericaceae | Vaccinium myrtillus L. | Ref. |
Plantae | Ericaceae | Vaccinium padifolium | Ref. |
Plantae | Ericaceae | Vaccinium spp. | Ref. |
Plantae | Fabaceae | Astragalus sinicus | Ref. |
Plantae | Fabaceae | Cercis chinensis | Ref. |
Plantae | Fabaceae | Clitoria ternatea | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lespedeza penduliflora | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Vigna subterranea | Ref. |
Plantae | Fouquieriacea | Fouquieria spp. | Ref. |
Plantae | Hyacinthaceae | Muscari armeniacum | Ref. |
Plantae | Lythraceae | Lagerstroemia indica | Ref. |
Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
Plantae | Myrtaceae | Metrosideros spp. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Orchidaceae | Broughtonia spp. | Ref. |
Plantae | Passifloraceae | Passiflora suberosa | Ref. |
Plantae | Pinaceae | Abies spp. | Ref. |
Plantae | Pinaceae | Picea spp. | Ref. |
Plantae | Pinaceae | Pinus banksiana | Ref. |
Plantae | Pinaceae | Pseudotsuga spp. | Ref. |
Plantae | Pinaceae | Tsuga spp. | Ref. |
Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zingiberaceae | Renealmia regmelliana | Ref. |
|
|
zoom in
Organism | Lagerstroemia indica | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Pomilio,Phytochem.,12,(1973),218
Carreno-Diaz,J.Food Sci.,34,(1969),415 |
---|
|