Name |
Myrtillin Delphinidin 3-O-beta-D-glucopyranoside |
Formula |
C21H21O12.Cl |
Mw |
500.07215385 |
CAS RN |
6906-38-3 |
C_ID |
C00006698
,
|
InChIKey |
XENHPQQLDPAYIJ-ABIWRIGZNA-O |
InChICode |
InChI=1S/C21H20O12/c22-6-15-17(28)18(29)19(30)21(33-15)32-14-5-9-10(24)3-8(23)4-13(9)31-20(14)7-1-11(25)16(27)12(26)2-7/h1-5,15,17-19,21-22,28-30H,6H2,(H4-,23,24,25,26,27)/p+1/t15-,17-,18+,19-,21-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1cc(c(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Balsaminaceae | Impatiens balsamina | Ref. |
Plantae | Boraginaceae | Lobostemon spp. | Ref. |
Plantae | Commelinaceae | Commelina communis | Ref. |
Plantae | Ericaceae | Vaccinium myrtillus L. | Ref. |
Plantae | Ericaceae | Vaccinium padifolium | Ref. |
Plantae | Ericaceae | Vaccinium spp. | Ref. |
Plantae | Fabaceae | Clitoria ternatea | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Mucuna sempervirens | Ref. |
Plantae | Fabaceae | Phaseolus coccineus | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Vigna spp. | Ref. |
Plantae | Geraniaceae | Geranium sylvaticum | Ref. |
Plantae | Grossulariaceae | Ribes nigrum | Ref. |
Plantae | Hyacinthaceae | Muscari armeniacum | Ref. |
Plantae | Hydrangeaceae | Hydrangea macrophylla | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Muntingiaceae | Muntingia calabura | Ref. |
Plantae | Myrsinaceae | Ardisia humilis | Ref. |
Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
Plantae | Myrtaceae | Metrosideros spp. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Passifloraceae | Passiflora suberosa | Ref. |
Plantae | Pinaceae | Abies spp. | Ref. |
Plantae | Pinaceae | Picea spp. | Ref. |
Plantae | Pinaceae | Pinus banksiana | Ref. |
Plantae | Pinaceae | Pseudotsuga spp. | Ref. |
Plantae | Pinaceae | Tsuga spp. | Ref. |
Plantae | Plumbaginaceae | Limonium spp. | Ref. |
Plantae | Plumbaginaceae | Plumbago spp. | Ref. |
Plantae | Poaceae | Alopecurus spp. | Ref. |
Plantae | Poaceae | Anthoxanthum spp. | Ref. |
Plantae | Poaceae | Avenula spp. | Ref. |
Plantae | Poaceae | Bothriochloa spp. | Ref. |
Plantae | Poaceae | Dactylis spp. | Ref. |
Plantae | Poaceae | Deschampsia spp. | Ref. |
Plantae | Poaceae | Elymus spp. | Ref. |
Plantae | Poaceae | Festuca spp. | Ref. |
Plantae | Poaceae | Hordeum spp. | Ref. |
Plantae | Poaceae | Miscanthus spp. | Ref. |
Plantae | Poaceae | Molinia spp. | Ref. |
Plantae | Poaceae | Oryza spp. | Ref. |
Plantae | Poaceae | Phalaris spp. | Ref. |
Plantae | Poaceae | Phleum spp. | Ref. |
Plantae | Poaceae | Poa spp. | Ref. |
Plantae | Poaceae | Sinarundinaria spp. | Ref. |
Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
Plantae | Polygonaceae | Polygonum spp. | Ref. |
Plantae | Salicaceae | Salix spp. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Ternstroemiaceae | Visnea mocanera | Ref. |
Plantae | Verbenaceae | Verbena x hybrida | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
Organism | Vaccinium spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Karrer,Helv.Chim.Acta,16,(1933),292
Reynolds,J.Chem.Soc.,(1934),1039 |
---|
|