Name |
Kaempferol 3-O-beta-D-(6''-E-p-coumaroyl)glucopyranoside Tiliroside Kaempferol 3-O-beta-D-(6''-coumaroyl)-glucopyranoside Potengriffioside A |
Formula |
C30H26O13 |
Mw |
594.13734092 |
CAS RN |
20316-62-5 |
C_ID |
C00005851
,
|
InChIKey |
DVGGLGXQSFURLP-PMXORBILNA-N |
InChICode |
InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2/b10-3+/t21-,24-,26-,27-,30+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@@H]([C@@H]([C@H](O1)COC(=O)/C=C/c1ccc(cc1)O)O)O)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Amaranthaceae | Aerva lanata | Ref. |
Plantae | Asteraceae | Anaphalis contorta Hooker | Ref. |
Plantae | Asteraceae | Helichrysum italicum | Ref. |
Plantae | Cistaceae | Helianthemum glomeratum | Ref. |
Plantae | Dennstaedtiaceae | Pteridium aquilinum | Ref. |
Plantae | Elaeagnaceae | Shepherdia argentea | Ref. |
Plantae | Fagaceae | Castanea sativa | Ref. |
Plantae | Fagaceae | Quercus ilex | Ref. |
Plantae | Fagaceae | Quercus suber | Ref. |
Plantae | Labiatae | Leonurus heterophyllus | Ref. |
Plantae | Labiatae | Phlomis spectabilis | Ref. |
Plantae | Lauraceae | Lindera megaphylla | Ref. |
Plantae | Malvaceae | Colona auriculata | Ref. |
Plantae | Malvaceae | Sida galheirensis | Ref. |
Plantae | Malvaceae | Tilia argentea | Ref. |
Plantae | Malvaceae | Tilia spp. | Ref. |
Plantae | Melastomataceae | Miconia cabucu | Ref. |
Plantae | Pinaceae | Pinus banksiana | Ref. |
Plantae | Pinaceae | Pinus contorta | Ref. |
Plantae | Platanaceae | Platanus acerifolia | Ref. |
Plantae | Rosaceae | Fragaria ananassa | Ref. |
Plantae | Rosaceae | Polylepis incana | Ref. |
Plantae | Rosaceae | Potentilla anserina | Ref. |
Plantae | Rosaceae | Potentilla griffithii var.velutina | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Thymelaeaceae | Daphne genkwa | Ref. |
Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
Plantae | Zygophyllaceae | Tribulus terrestris | Ref. |
- | - | Chamaenerion angustifolium | Ref. |
- | - | Sparuna apiosyce | Ref. |
|
|
zoom in
Organism | Aerva lanata | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Higuchi,Phytochem.,17,(1978),787
Vermes,Helv.Chim.Acta,64,(1981),1964 |
---|
|