Name |
Kaempferol 3,7-di-O-glucoside Kaempferol 3,7-O-beta-D-diglucopyranoside Kaempferol 3,7-diglucoside Kaempferol-3,7-diglucoside |
Formula |
C27H30O16 |
Mw |
610.15338491 |
CAS RN |
25615-14-9 |
C_ID |
C00005182
,
|
InChIKey |
XFFQVRFGLSBFON-AVNJKGJRNA-N |
InChICode |
InChI=1S/C27H30O16/c28-7-14-17(32)20(35)22(37)26(41-14)39-11-5-12(31)16-13(6-11)40-24(9-1-3-10(30)4-2-9)25(19(16)34)43-27-23(38)21(36)18(33)15(8-29)42-27/h1-6,14-15,17-18,20-23,26-33,35-38H,7-8H2/t14-,15-,17-,18-,20+,21-,22-,23-,26-,27+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@@H]([C@@H]([C@H](O1)CO)O)O)O)c1ccc(cc1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Amaryllidaceae | Narcissus poeticus | Ref. |
Plantae | Aspleniaceae | Asplenium bulbiferum | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cruciferae | Sinapis arvensis | Ref. |
Plantae | Cruciferae | Sisymbrium spp. | Ref. |
Plantae | Cucurbitaceae | Marah oreganus | Ref. |
Plantae | Equisetaceae | Equisetum arvense | Ref. |
Plantae | Equisetaceae | Equisetum debile | Ref. |
Plantae | Equisetaceae | Equisetum hiemale | Ref. |
Plantae | Equisetaceae | Equisetum palustre | Ref. |
Plantae | Equisetaceae | Equisetum pratense | Ref. |
Plantae | Equisetaceae | Equisetum sylvaticum | Ref. |
Plantae | Equisetaceae | Equisetum telmateja | Ref. |
Plantae | Fabaceae | Acacia mangium | Ref. |
Plantae | Fabaceae | Medicago polymorpha | Ref. |
Plantae | Fabaceae | Medicago radiata | Ref. |
Plantae | Fabaceae | Ononis natrix | Ref. |
Plantae | Fabaceae | Trigonella coerulescens | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vicia sepium | Ref. |
Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Paeoniaceae | Paeonia albiflora | Ref. |
Plantae | Pteridaceae | Adiantum capillus-veneris | Ref. |
Plantae | Saxifragaceae | Heuchera micrantha | Ref. |
Plantae | Solanaceae | Petunia x hybrida | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum spp. | Ref. |
Plantae | Zygophyllaceae | Tribulus pentandrus | Ref. |
|
|
zoom in
Organism | Paeonia albiflora | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Egger,Z.Naturforsch.B.,16,(1961),430
Vermes,Phytochem.,15,(1976),1320 |
---|
|