Name |
Afzelin Kaempferol 3-O-rhamnoside Kaempferol 3-O-alpha-rhamnoside Kaempferol 3-O-alpha-L-rhamnopyranoside Kaempferol-3-rhamnoside Kaempherol 3-O-alpha-rhamnoside |
Formula |
C21H20O10 |
Mw |
432.10564686 |
CAS RN |
482-39-3 |
C_ID |
C00005140
,
|
InChIKey |
SOSLMHZOJATCCP-OVDJVLJZNA-N |
InChICode |
InChI=1S/C21H20O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-18,21-25,27-28H,1H3/t8-,15-,17+,18-,21-/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)C)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Rhus parviflora | Ref. |
Plantae | Annonaceae | Annona purpurea | Ref. |
Plantae | Annonaceae | Guatteria rupestris | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
Plantae | Asteraceae | Clibadium spp. | Ref. |
Plantae | Berberidaceae | Epimedium sagittatum | Ref. |
Plantae | Betulaceae | Alnus japonica | Ref. |
Plantae | Canellaceae | Warburgia stuhlmannii | Ref. |
Plantae | Chenopodiaceae | Chenopodium murale | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bancana MIQ | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus controversa | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cunoniaceae | Davidsonia pruriens | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
Plantae | Ephedraceae | Ephedra alata | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Erythroxylaceae | Erythroxylum subsessile | Ref. |
Plantae | Euphorbiaceae | Euphorbia lunulata | Ref. |
Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis | Ref. |
Plantae | Euphorbiaceae | Mallotus metcalfianus | Ref. |
Plantae | Fabaceae | Afzelia spp. | Ref. |
Plantae | Fabaceae | Cassia grandis | Ref. |
Plantae | Fabaceae | Flemingia stricta | Ref. |
Plantae | Fabaceae | Millettia zechiana | Ref. |
Plantae | Fabaceae | Sindora siamensis | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Geraniaceae | Geranium rotundifolium | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
Plantae | Gleicheniaceae | Dicranopteris spp. | Ref. |
Plantae | Juglandaceae | Juglans mandshurica | Ref. |
Plantae | Labiatae | Ajuga remota | Ref. |
Plantae | Lauraceae | Beilschmiedia miersii | Ref. |
Plantae | Lauraceae | Neolitsea konishii | Ref. |
Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
Plantae | Loranthaceae | Dendrophthoe falcata | Ref. |
Plantae | Loranthaceae | Hyphear tanakae | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Nymphaeaceae | Nymphaea odorata | Ref. |
Plantae | Ochnaceae | Ochna beddomei | Ref. |
Plantae | Onagraceae | Heterogaura heterandra | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Pinaceae | Abies amabilis | Ref. |
Plantae | Piperaceae | Piper umbellatum | Ref. |
Plantae | Platanaceae | Platanus acerifolia | Ref. |
Plantae | Polygalaceae | Polygala chinensis | Ref. |
Plantae | Resedaceae | Ochradenus baccatus | Ref. |
Plantae | Rosaceae | Agrimonia eupatoria | Ref. |
Plantae | Rosaceae | Rosa multiflora | Ref. |
Plantae | Rubiaceae | Morinda morindoides | Ref. |
Plantae | Rutaceae | Euodia alata | Ref. |
Plantae | Rutaceae | Leptothyrsa sprucei | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Rutaceae | Zanthoxylum culantrillo | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saxifragaceae | Heuchera spp. | Ref. |
Plantae | Saxifragaceae | Lithophragma spp. | Ref. |
Plantae | Saxifragaceae | Rodgersia podophylla | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Zingiberaceae | Zingiber aromaticum | Ref. |
Plantae | Zingiberaceae | Zingiber zerumbe | Ref. |
Plantae | Zingiberaceae | Zingiber zerumbet | Ref. |
- | - | Sarcolaeana multiflora | Ref. |
- | - | Tapirira guianensis | Ref. |
|
|
zoom in
Organism | Cassia grandis | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|