Name |
5-Hydroxy-3,7,3',4'-tetramethoxyflavone Retusin(Ariocarpus) Quercetin 3,7,3',4'-tetramethyl ether Retusine 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one Retusin |
Formula |
C19H18O7 |
Mw |
358.10525293 |
CAS RN |
1245-15-4 |
C_ID |
C00004653
,
|
InChIKey |
HHGPYJLEJGNWJA-UHFFFAOYSA-N |
InChICode |
InChI=1S/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)OC)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia rupestris | Ref. |
Plantae | Asteraceae | Brickellia eupatorioides | Ref. |
Plantae | Asteraceae | Grindelia nana | Ref. |
Plantae | Asteraceae | Grindelia tenella | Ref. |
Plantae | Asteraceae | Parthenium spp. | Ref. |
Plantae | Asteraceae | Urolepis hecatantha | Ref. |
Plantae | Asteraceae | Xanthocephalum gymnospermoides | Ref. |
Plantae | Betulaceae | Betula nigra | Ref. |
Plantae | Boraginaceae | Cordia multispicata | Ref. |
Plantae | Cactaceae | Ariocarpus retusus | Ref. |
Plantae | Crassulaceae | Aeonium lindleyi | Ref. |
Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
Plantae | Fabaceae | Dalbergia retusa | Ref. |
Plantae | Geraniaceae | Geranium macrorrhizum L. | Ref. |
Plantae | Labiatae | Agastache rugosus | Ref. |
Plantae | Labiatae | Origanum akhadarense | Ref. |
Plantae | Labiatae | Origanum boissieri | Ref. |
Plantae | Labiatae | Origanum hypercifolium | Ref. |
Plantae | Labiatae | Origanum micranthum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus cunninghamii | Ref. |
Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
Plantae | Orchidaceae | Spiranthes australis (R.BROWN) LINDL. | Ref. |
Plantae | Phyllanthaceae | Bridelia ferruginea | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Evodia merrillii | Ref. |
Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
Plantae | Solanaceae | Solanum paludosum | Ref. |
Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
Plantae | Zingiberaceae | Amomum koenigii | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
Plantae | Zygophyllaceae | Larrea cuneifolia | Ref. |
Plantae | Zygophyllaceae | Larrea divaricata | Ref. |
Plantae | Zygophyllaceae | Larrea tridentata | Ref. |
- | - | Siegesbeckia jorullensis | Ref. |
- | - | Siegesbeckia orientalis | Ref. |
|
|
zoom in
Organism | Origanum boissieri | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|