Name |
Tricin 7-O-beta-D-glucopyranoside Tricin 7-O-glucoside Tricin 7-glucoside |
Formula |
C23H24O12 |
Mw |
492.12677623 |
CAS RN |
32769-01-0 |
C_ID |
C00004444
,
|
InChIKey |
JGXFMIJHKASCIZ-GWXIPAPMNA-N |
InChICode |
InChI=1S/C23H24O12/c1-31-15-3-9(4-16(32-2)19(15)27)13-7-12(26)18-11(25)5-10(6-14(18)34-13)33-23-22(30)21(29)20(28)17(8-24)35-23/h3-7,17,20-25,27-30H,8H2,1-2H3/t17-,20+,21-,22+,23+/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1cc(c(c(c1)OC)O)OC)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Crassulaceae | Sedum sarmentosum | Ref. |
Plantae | Labiatae | Stachys alopecuros (L.) Benth. | Ref. |
Plantae | Labiatae | Stachys officinalis (L.) Trev. | Ref. |
Plantae | Labiatae | Stachys scardica Griseb. | Ref. |
Plantae | Palmae | Butia capitata | Ref. |
Plantae | Palmae | Rhopaloblaste singaporensis | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Oryza spp. | Ref. |
Plantae | Poaceae | Triticum spp. | Ref. |
Plantae | Ranunculaceae | Ranunculus japonicus | Ref. |
Plantae | Rhizophoraceae | Bruguiera sexangula var.rhynchopetala | Ref. |
|
|
zoom in
Organism | Butia capitata | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Kuwatsuka,Nippon Nogei Kagaku Kaishi,38,(1964),351 |
---|
|