Name |
4 5,6-Dihydroxy-7,3',4'-trimethoxyflavone 6-Hydroxyluteolin 7,3',4'-trimethyl ether 5,6-Dihydroxy-7,3',4'-Trimethoxyflavone 2-(3,4-Dimethoxyphenyl)-5,6-dihydroxy-7-methoxy-4H-1-benzopyran-4-one |
Formula |
C18H16O7 |
Mw |
344.08960287 |
CAS RN |
25782-23-4 |
C_ID |
C00003895
,
|
InChIKey |
QIEMGQKOGFTYLN-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O7/c1-22-11-5-4-9(6-13(11)23-2)12-7-10(19)16-14(25-12)8-15(24-3)17(20)18(16)21/h4-8,20-21H,1-3H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(c(c1)OC)OC)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia argyi | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Mentha x piperita | Ref. |
Plantae | Labiatae | Micromeria spp. | Ref. |
Plantae | Labiatae | Ocimum lamiifolium | Ref. |
Plantae | Labiatae | Origanum calcaratum | Ref. |
Plantae | Labiatae | Origanum dictamnus | Ref. |
Plantae | Labiatae | Origanum floribundum | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum microphyllum | Ref. |
Plantae | Labiatae | Origanum onites | Ref. |
Plantae | Labiatae | Origanum syriacum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Glandulosum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Hirtum | Ref. |
Plantae | Labiatae | Salvia sclarea | Ref. |
Plantae | Labiatae | Salvia syriaca | Ref. |
Plantae | Labiatae | Satureja thymbra | Ref. |
Plantae | Labiatae | Thymbra capitata | Ref. |
Plantae | Labiatae | Thymbra spicata | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
Plantae | Lamiaceae | Calamintha nepeta | Ref. |
|
|
zoom in
Organism | Origanum floribundum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|