Name |
beta-Betulinic acid Betulinic acid |
Formula |
C30H48O3 |
Mw |
456.3603454 |
CAS RN |
472-15-1 |
C_ID |
C00003741
,
|
InChIKey |
QGJZLNKBHJESQX-VIXGVLKJNA-N |
InChICode |
InChI=1S/C30H48O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-24,31H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@](C1)([C@@H]1[C@@](CC2)([C@]2([C@H](CC1)[C@@H]1[C@@](CC2)(CC[C@H]1C(=C)C)C(=O)O)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Amaranthaceae | Achyranthes aspera | Ref. |
Plantae | Annonaceae | Goniothalamus thwaitesii | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Apocynaceae | Nerium oleander | Ref. |
Plantae | Apocynaceae | Plumeria obtusa | Ref. |
Plantae | Araceae | Arum maculatum L. | Ref. |
Plantae | Asteraceae | Cichorium intybus | Ref. |
Plantae | Betulaceae | Betula utilis | Ref. |
Plantae | Cactaceae | Stenocereus eruca | Ref. |
Plantae | Campanulaceae | Clermontia fauriei | Ref. |
Plantae | Caryophyllaceae | Gypsophila struthium | Ref. |
Plantae | Chrysobalanaceae | Couepia polyandra | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Clusia nemorosa | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Clusiaceae-Guttiferae | Tovomita brasiliensis | Ref. |
Plantae | Combretaceae | Terminalia fagifolia | Ref. |
Plantae | Combretaceae | Terminalia superba | Ref. |
Plantae | Cornaceae | Camptotheca acuminata | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus florida L. | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Dichapetalaceae | Dichapetalum gelonioides | Ref. |
Plantae | Dilleniaceae | Dillenia indica | Ref. |
Plantae | Dilleniaceae | Dillenia serrata | Ref. |
Plantae | Dilleniaceae | Tetracera boiviniana | Ref. |
Plantae | Dipterocarpaceae | Vatica cinerea | Ref. |
Plantae | Ebenaceae | Diospyros abyssinica | Ref. |
Plantae | Ebenaceae | Diospyros alboflavescens | Ref. |
Plantae | Ebenaceae | Diospyros argentea | Ref. |
Plantae | Ebenaceae | Diospyros bipindensis | Ref. |
Plantae | Ebenaceae | Diospyros buxifolia | Ref. |
Plantae | Ebenaceae | Diospyros canaliculata | Ref. |
Plantae | Ebenaceae | Diospyros candalleana | Ref. |
Plantae | Ebenaceae | Diospyros castanea | Ref. |
Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
Plantae | Ebenaceae | Diospyros chevalieri | Ref. |
Plantae | Ebenaceae | Diospyros chloroxylon | Ref. |
Plantae | Ebenaceae | Diospyros cinnabarina | Ref. |
Plantae | Ebenaceae | Diospyros consolatae | Ref. |
Plantae | Ebenaceae | Diospyros cornii | Ref. |
Plantae | Ebenaceae | Diospyros crassiflora | Ref. |
Plantae | Ebenaceae | Diospyros curranii | Ref. |
Plantae | Ebenaceae | Diospyros dendo | Ref. |
Plantae | Ebenaceae | Diospyros diepenhorstii | Ref. |
Plantae | Ebenaceae | Diospyros discolor | Ref. |
Plantae | Ebenaceae | Diospyros ebenum | Ref. |
Plantae | Ebenaceae | Diospyros ehretioides | Ref. |
Plantae | Ebenaceae | Diospyros elliptifolia | Ref. |
Plantae | Ebenaceae | Diospyros embryopteris | Ref. |
Plantae | Ebenaceae | Diospyros eriantha | Ref. |
Plantae | Ebenaceae | Diospyros evena | Ref. |
Plantae | Ebenaceae | Diospyros exsculpta | Ref. |
Plantae | Ebenaceae | Diospyros ferrea | Ref. |
Plantae | Ebenaceae | Diospyros fragrans | Ref. |
Plantae | Ebenaceae | Diospyros gabunensis | Ref. |
Plantae | Ebenaceae | Diospyros gilleti | Ref. |
Plantae | Ebenaceae | Diospyros gracilescens | Ref. |
Plantae | Ebenaceae | Diospyros greeniway | Ref. |
Plantae | Ebenaceae | Diospyros guianensis | Ref. |
Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
Plantae | Ebenaceae | Diospyros hoyleana | Ref. |
Plantae | Ebenaceae | Diospyros ismailii | Ref. |
Plantae | Ebenaceae | Diospyros iturensis | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ebenaceae | Diospyros kaki var.sylvestris | Ref. |
Plantae | Ebenaceae | Diospyros kamerunensis | Ref. |
Plantae | Ebenaceae | Diospyros leucomelas | Ref. |
Plantae | Ebenaceae | Diospyros longiflora | Ref. |
Plantae | Ebenaceae | Diospyros lotus | Ref. |
Plantae | Ebenaceae | Diospyros mafiensis | Ref. |
Plantae | Ebenaceae | Diospyros maingayi | Ref. |
Plantae | Ebenaceae | Diospyros malanonilau | Ref. |
Plantae | Ebenaceae | Diospyros mannii | Ref. |
Plantae | Ebenaceae | Diospyros maritima | Ref. |
Plantae | Ebenaceae | Diospyros melanoxylon | Ref. |
Plantae | Ebenaceae | Diospyros mespiliformis | Ref. |
Plantae | Ebenaceae | Diospyros monobuttensis | Ref. |
Plantae | Ebenaceae | Diospyros montana | Ref. |
Plantae | Ebenaceae | Diospyros moonii | Ref. |
Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
Plantae | Ebenaceae | Diospyros natalensis | Ref. |
Plantae | Ebenaceae | Diospyros obliquifolia | Ref. |
Plantae | Ebenaceae | Diospyros palmeri | Ref. |
Plantae | Ebenaceae | Diospyros peregrina | Ref. |
Plantae | Ebenaceae | Diospyros pseudo-malabarica | Ref. |
Plantae | Ebenaceae | Diospyros quaesita | Ref. |
Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
Plantae | Ebenaceae | Diospyros sanza-minika | Ref. |
Plantae | Ebenaceae | Diospyros siamang | Ref. |
Plantae | Ebenaceae | Diospyros siamensis | Ref. |
Plantae | Ebenaceae | Diospyros siderophylla | Ref. |
Plantae | Ebenaceae | Diospyros singaporensis | Ref. |
Plantae | Ebenaceae | Diospyros spinescens | Ref. |
Plantae | Ebenaceae | Diospyros sumatrana | Ref. |
Plantae | Ebenaceae | Diospyros sylvatica | Ref. |
Plantae | Ebenaceae | Diospyros thwaitesii | Ref. |
Plantae | Ebenaceae | Diospyros tomentosa | Ref. |
Plantae | Ebenaceae | Diospyros verrucosa | Ref. |
Plantae | Ebenaceae | Diospyros virginiana | Ref. |
Plantae | Ebenaceae | Diospyros walkeri | Ref. |
Plantae | Ebenaceae | Diospyros wallichii | Ref. |
Plantae | Ebenaceae | Diospyros zenkeri | Ref. |
Plantae | Ericaceae | Enkianthus cernuus | Ref. |
Plantae | Ericaceae | Epigaea asiatica | Ref. |
Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
Plantae | Ericaceae | Pieris japonica D.Don. | Ref. |
Plantae | Ericaceae | Rhododendron arboreum | Ref. |
Plantae | Euphorbiaceae | Euphorbia micractina | Ref. |
Plantae | Fabaceae | Acacia mellifera | Ref. |
Plantae | Fabaceae | Bauhinia vahlii L. | Ref. |
Plantae | Fabaceae | Cassia spectabilis | Ref. |
Plantae | Fabaceae | Eysenhardtia platycarpa | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Harpalyce brasiliana | Ref. |
Plantae | Fabaceae | Hedysarum multijugum | Ref. |
Plantae | Fabaceae | Lespedeza bicolor | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Millettia pinnata | Ref. |
Plantae | Fabaceae | Pongamia pinnata | Ref. |
Plantae | Hypericaceae | Harungana madagascariensis | Ref. |
Plantae | Hypericaceae | Psorospermum glaberrimum | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Origanum compactum | Ref. |
Plantae | Labiatae | Orthosiphon stamineus | Ref. |
Plantae | Labiatae | Rosmarinus officinalis L. | Ref. |
Plantae | Labiatae | Salvia nicolsoniana | Ref. |
Plantae | Labiatae | Salvia roborowskii | Ref. |
Plantae | Labiatae | Salvia virgata | Ref. |
Plantae | Labiatae | Thymus caramanicus | Ref. |
Plantae | Labiatae | Thymus persicus | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lardizabalaceae | Stauntonia hexahylla | Ref. |
Plantae | Lauraceae | Beilschmiedia zenkeri | Ref. |
Plantae | Lecythidaceae | Gustavia hexapetala | Ref. |
Plantae | Lythraceae | Lawsonia alba | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Adansonia digitata | Ref. |
Plantae | Malvaceae | Helicteres angustifolia | Ref. |
Plantae | Melastomataceae | Henriettella fascicularis | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moraceae | Morus australis | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis var.obtusa | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora | Ref. |
Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
Plantae | Myrtaceae | Melaleuca ericifolia | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendron | Ref. |
Plantae | Myrtaceae | Syzygium cumini | Ref. |
Plantae | Myrtaceae | Syzygium formosanum | Ref. |
Plantae | Oleaceae | Jasminum lanceolarium | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Paeoniaceae | Paeonia suffruticosa | Ref. |
Plantae | Phyllanthaceae | Phyllanthus reticulatus | Ref. |
Plantae | Phyllanthaceae | Phyllanthus urinaria | Ref. |
Plantae | Piperaceae | Peperomia sui | Ref. |
Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
Plantae | Plantaginaceae | Scoparia dulcis L. | Ref. |
Plantae | Plantaginaceae | Stemodia foliosa | Ref. |
Plantae | Platanaceae | Platanus occidentalis | Ref. |
Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
Plantae | Ranunculaceae | Anemone rivularis | Ref. |
Plantae | Rhamnaceae | Alphitonia excelsa Boiss. | Ref. |
Plantae | Rhamnaceae | Alphitonia petriei Braid et White. | Ref. |
Plantae | Rhamnaceae | Alphitonia whitei Braid | Ref. |
Plantae | Rhamnaceae | Alphitonia zizyphoides | Ref. |
Plantae | Rhamnaceae | Ziziphus cambodiana | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa | Ref. |
Plantae | Rhamnaceae | Zizyphus joazeiro | Ref. |
Plantae | Rhamnaceae | Zizyphus vulgaris | Ref. |
Plantae | Rhizophoraceae | Ceriops tagal | Ref. |
Plantae | Rosaceae | Chaenomeles sinensis KOEHNE | Ref. |
Plantae | Rosaceae | Rosa multiflora | Ref. |
Plantae | Rubiaceae | Coussarea paniculata | Ref. |
Plantae | Rubiaceae | Mitragyna inermis | Ref. |
Plantae | Rubiaceae | Psychotria adenophylla | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Sapindaceae | Schleichera oleosa | Ref. |
Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia cherryi | Ref. |
Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia merrilliana | Ref. |
Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
- | - | Machaerocereus eruca | Ref. |
- | - | Moldenhavera nutans | Ref. |
- | - | Syzigium claviflorum | Ref. |
- | - | Zizphus cambodiana | Ref. |
|
|
zoom in
Organism | Origanum compactum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|