Name |
beta-Stigmasterol Stigmasterol |
Formula |
C29H48O |
Mw |
412.37051615 |
CAS RN |
83-48-7 |
C_ID |
C00003674
,
|
InChIKey |
HCXVJBMSMIARIN-WCWSWCBANA-N |
InChICode |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-10,19-21,23-27,30H,7,11-18H2,1-6H3/b9-8+/t20-,21+,23-,24-,25+,26-,27-,28-,29+/m0/s1 |
SMILES |
C1[C@@H](CC2=CC[C@@H]3[C@@H]([C@]2(C1)C)CC[C@]1([C@H]3CC[C@@H]1[C@H](/C=C/[C@H](C(C)C)CC)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
Chromalveolata | Pelagophyceae | Aureoumbra lagunensis | Ref. |
Fungi | Elaphomycetaceae | Monascus pilosus BCRC38072 | Ref. |
Fungi | Meripilaceae | Antrodia camphorata | Ref. |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | Acanthaceae | Justicia heterocarpa T.ANDERS | Ref. |
Plantae | Acanthaceae | Ruellia tuberosa | Ref. |
Plantae | Acanthaceae | Strobilanthes japonicus | Ref. |
Plantae | Adoxaceae | Sambucus canadensis | Ref. |
Plantae | Adoxaceae | Sambucus nigra. | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Amaranthaceae | Blutaparon portulacoides | Ref. |
Plantae | Amaranthaceae | Gomphrena celosioides | Ref. |
Plantae | Annonaceae | Annona glabra | Ref. |
Plantae | Annonaceae | Annona purpurea | Ref. |
Plantae | Annonaceae | Artabotrys uncinatus | Ref. |
Plantae | Annonaceae | Goniothalamus amuyon | Ref. |
Plantae | Annonaceae | Polyalthia longifolia var.pendula | Ref. |
Plantae | Annonaceae | Xylopia aromatica | Ref. |
Plantae | Annonaceae | Xylopia brasiliensis | Ref. |
Plantae | Annonaceae | Xylopia emarginata | Ref. |
Plantae | Anthericaceae | Chlorophytum arundinaceum | Ref. |
Plantae | Apiaceae | Angelica sinensis | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Apiaceae | Ferula diversivittata | Ref. |
Plantae | Apiaceae | Ferula szowitsiana | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Glehnia littoralis | Ref. |
Plantae | Apiaceae | Heracleum wallichii | Ref. |
Plantae | Apocynaceae | Alstonia scholaris | Ref. |
Plantae | Araliaceae | Acanthopanax sessiliflorus | Ref. |
Plantae | Araliaceae | Cussonia bancoensis | Ref. |
Plantae | Araliaceae | Eleutherococcus senticosus Rupr.and Maxim. | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Araliaceae | Panax pseudo-ginseng var.notoginseng | Ref. |
Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl | Ref. |
Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
Plantae | Aristolochiaceae | Aristolochia mollissima | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asphodelaceae | Asphodelus albus | Ref. |
Plantae | Asteraceae | Achillea millefolium | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Ageratum conyzoides | Ref. |
Plantae | Asteraceae | Artemisia annua L. | Ref. |
Plantae | Asteraceae | Artemisia argyi | Ref. |
Plantae | Asteraceae | Artemisia sieversiana | Ref. |
Plantae | Asteraceae | Artemisia vulgaris | Ref. |
Plantae | Asteraceae | Calendula officinalis L. | Ref. |
Plantae | Asteraceae | Carpesium abrotanoides | Ref. |
Plantae | Asteraceae | Centipeda minima | Ref. |
Plantae | Asteraceae | Cichorium intybus | Ref. |
Plantae | Asteraceae | Cirsium japonicum | Ref. |
Plantae | Asteraceae | Conyza aegyptica | Ref. |
Plantae | Asteraceae | Elephantopus scaber | Ref. |
Plantae | Asteraceae | Eupatorium adenophorum | Ref. |
Plantae | Asteraceae | Eupatorium macrocephalum Lee. | Ref. |
Plantae | Asteraceae | Gonospermum gomerae | Ref. |
Plantae | Asteraceae | Gynura segetum | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Hertia cheirifolia | Ref. |
Plantae | Asteraceae | Heterothalamus spartioides | Ref. |
Plantae | Asteraceae | Inula anatolica | Ref. |
Plantae | Asteraceae | Inula cappa | Ref. |
Plantae | Asteraceae | Lactuca indica | Ref. |
Plantae | Asteraceae | Launaea arborescens | Ref. |
Plantae | Asteraceae | Pluchea indica Less. | Ref. |
Plantae | Asteraceae | Pulicaria canariensis | Ref. |
Plantae | Asteraceae | Robinsonecio gerberifolius | Ref. |
Plantae | Asteraceae | Saussurea lappa | Ref. |
Plantae | Asteraceae | Saussurea muliensis | Ref. |
Plantae | Asteraceae | Senecio viravira | Ref. |
Plantae | Asteraceae | Stevia porphyrea | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Asteraceae | Xanthium sibiricum | Ref. |
Plantae | Asteraceae | Xanthium strumarium | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Betulaceae | Corylus avellana | Ref. |
Plantae | Betulaceae | Corylus maxima | Ref. |
Plantae | Boraginaceae | Heliotropium indicum | Ref. |
Plantae | Boraginaceae | Heliotropium marifolium | Ref. |
Plantae | Buddlejaceae | Buddleja madagascariensis | Ref. |
Plantae | Calycanthaceae | Calycanthus floridus | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula var.modesta | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis subglobosa | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen | Ref. |
Plantae | Canellaceae | Cinnamosma madagascariensis | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Chrysobalanaceae | Couepia polyandra | Ref. |
Plantae | Clusiaceae | Pentaphalangium solomonse Warb. | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia afzelii ENGL. | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bancana MIQ | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia multiflora | Ref. |
Plantae | Clusiaceae-Guttiferae | Allanblackia floribunda | Ref. |
Plantae | Clusiaceae-Guttiferae | Tovomita brasiliensis | Ref. |
Plantae | Combretaceae | Pteleopsis hylodendron | Ref. |
Plantae | Combretaceae | Terminalia superba | Ref. |
Plantae | Convallariaceae | Ophiopogon japonicus | Ref. |
Plantae | Convallariaceae | Tupistra chinensis | Ref. |
Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Brassica rapa | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Herpetospermum caudigerum WALL | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
Plantae | Dioscoreaceae | Dioscorea batatas | Ref. |
Plantae | Dioscoreaceae | Dioscorea cyphocarpa | Ref. |
Plantae | Dioscoreaceae | Tamus communis L. | Ref. |
Plantae | Ebenaceae | Diospyros buxifolia | Ref. |
Plantae | Ebenaceae | Diospyros castanea | Ref. |
Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
Plantae | Ebenaceae | Diospyros curranii | Ref. |
Plantae | Ebenaceae | Diospyros diepenhorstii | Ref. |
Plantae | Ebenaceae | Diospyros ebenum | Ref. |
Plantae | Ebenaceae | Diospyros evena | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ebenaceae | Diospyros mollis | Ref. |
Plantae | Ebenaceae | Diospyros montana | Ref. |
Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
Plantae | Ebenaceae | Diospyros sanza-minika | Ref. |
Plantae | Ebenaceae | Diospyros variegata | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Euphorbiaceae | Aleurites fordii Hemsl. | Ref. |
Plantae | Euphorbiaceae | Cleidion spiciflorum (Burm. f.) Merr. | Ref. |
Plantae | Euphorbiaceae | Croton urucurana Baill. | Ref. |
Plantae | Euphorbiaceae | Croton zambesicus | Ref. |
Plantae | Euphorbiaceae | Euphorbia indica | Ref. |
Plantae | Euphorbiaceae | Euphorbia lathyris | Ref. |
Plantae | Euphorbiaceae | Euphorbia sessiliflora Roxb. | Ref. |
Plantae | Euphorbiaceae | Manihot esculenta | Ref. |
Plantae | Euphorbiaceae | Trigonostemon reidioides | Ref. |
Plantae | Fabaceae | Abrus precatorius | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Astragalus glycyphyllos | Ref. |
Plantae | Fabaceae | Bauhinia candicans | Ref. |
Plantae | Fabaceae | Bauhinia vahlii L. | Ref. |
Plantae | Fabaceae | Butea monosperma | Ref. |
Plantae | Fabaceae | Caesalpinia decapetala | Ref. |
Plantae | Fabaceae | Caesalpinia minax | Ref. |
Plantae | Fabaceae | Caragana microphylla | Ref. |
Plantae | Fabaceae | Centrosema pubescens | Ref. |
Plantae | Fabaceae | Cicer arietinum | Ref. |
Plantae | Fabaceae | Dolichos lablab | Ref. |
Plantae | Fabaceae | Erythrina arborescens Roxb. | Ref. |
Plantae | Fabaceae | Erythrina indica | Ref. |
Plantae | Fabaceae | Eysenhardtia polystachya | Ref. |
Plantae | Fabaceae | Gleditsia sinensis LAM. | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Physostigma venenosum | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Prosopis spicigera | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Pterocarpus santalinus | Ref. |
Plantae | Fabaceae | Pterodon apraricioi | Ref. |
Plantae | Fabaceae | Pueraria tuberosa | Ref. |
Plantae | Fumariaceae | Corydalis remota | Ref. |
Plantae | Gentianaceae | Gentiana lutea L. | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
Plantae | Hydrocharitaceae | Halophila ovalis | Ref. |
Plantae | Hydrocharitaceae | Halophila ovata | Ref. |
Plantae | Hydrocharitaceae | Halophila spinulosa | Ref. |
Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
Plantae | Hypericaceae | Hypericum beanii | Ref. |
Plantae | Hypericaceae | Hypericum carinatum | Ref. |
Plantae | Hypericaceae | Vismia laurentii | Ref. |
Plantae | Iridaceae | Iris soforana | Ref. |
Plantae | Jubulaceae | Frullania brasiliensis | Ref. |
Plantae | Jubulaceae | Frullania monocera | Ref. |
Plantae | Labiatae | Ajuga taiwanensis | Ref. |
Plantae | Labiatae | Anisomeles indica | Ref. |
Plantae | Labiatae | Callicarpa pilosissima | Ref. |
Plantae | Labiatae | Leonurus persicus | Ref. |
Plantae | Labiatae | Leucas cephalotes SPRENG. | Ref. |
Plantae | Labiatae | Ocimum spicatum | Ref. |
Plantae | Labiatae | Perilla frutescens var.acuta | Ref. |
Plantae | Labiatae | Perilla frutescens var.crispa | Ref. |
Plantae | Labiatae | Salvia aegyptiaca | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
Plantae | Labiatae | Sideritis discolor | Ref. |
Plantae | Labiatae | Sideritis kuegleriana | Ref. |
Plantae | Labiatae | Sideritis lotsyi | Ref. |
Plantae | Labiatae | Sideritis lotsyi var. mascaensis | Ref. |
Plantae | Labiatae | Sideritis soluta | Ref. |
Plantae | Labiatae | Sideritis tenoi | Ref. |
Plantae | Lardizabalaceae | Akebia quinata | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum subavenium | Ref. |
Plantae | Lauraceae | Lindera obtusiloba | Ref. |
Plantae | Lauraceae | Neolitsea acuminatissima | Ref. |
Plantae | Lecythidaceae | Barringtonia racemosa | Ref. |
Plantae | Liliaceae | Lilium brownii var.viridulum | Ref. |
Plantae | Linaceae | Linum scabrellum | Ref. |
Plantae | Longaniaceae | Strychnos dolychothyrsa | Ref. |
Plantae | Longaniaceae | Strychnos potatorum | Ref. |
Plantae | Loranthaceae | Loranthus falcatus | Ref. |
Plantae | Lycopodiaceae | Lycopodium cernuum | Ref. |
Plantae | Lygodiaceae/Schizaeaceae | Lygodium flexuosum | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Malvaceae | Malva parviflora | Ref. |
Plantae | Malvaceae | Sida rhombifolia | Ref. |
Plantae | Meliaceae | Aphanamixis polystachya | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Meliaceae | Guarea rhophalocarpa | Ref. |
Plantae | Meliaceae | Khaya ivorensis | Ref. |
Plantae | Meliaceae | Khaya senegalensis L. | Ref. |
Plantae | Meliaceae | Toona sinensis | Ref. |
Plantae | Menispermaceae | Sinomenium acutum | Ref. |
Plantae | Menispermaceae | Tinospora crispa | Ref. |
Plantae | Moraceae | Brosimum acutifolium | Ref. |
Plantae | Moraceae | Ficus hirta | Ref. |
Plantae | Moraceae | Ficus septica | Ref. |
Plantae | Myristicaceae | Virola surinamensis | Ref. |
Plantae | Myrsinaceae | Embelia schimperi | Ref. |
Plantae | Myrtaceae | Feijoa sellowiana | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Ochnaceae | Ouratea sulcata | Ref. |
Plantae | Orchidaceae | Arundina chinensis | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Papaveraceae | Papaver somniferum | Ref. |
Plantae | Phyllanthaceae | Phyllanthus fraternus | Ref. |
Plantae | Piperaceae | Piper kadsura | Ref. |
Plantae | Piperaceae | Piper methysticum Forst.f. | Ref. |
Plantae | Piperaceae | Piper nigrum L. | Ref. |
Plantae | Piperaceae | Piper philippinum | Ref. |
Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
Plantae | Plantaginaceae | Plantago asiatica | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Stemodia foliosa | Ref. |
Plantae | Plantaginaceae | Veronica officinalis | Ref. |
Plantae | Plantaginaceae | Veronica orchidea | Ref. |
Plantae | Plantaginaceae | Veronica teucrium | Ref. |
Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
Plantae | Poaceae | Arundo donax | Ref. |
Plantae | Poaceae | Coix lacryma-jobi | Ref. |
Plantae | Poaceae | Hordeum vulgare L.cv Mammut | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Saccharum sinensis | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Poaceae | Zea mays L. | Ref. |
Plantae | Polygalaceae | Polygala arillata | Ref. |
Plantae | Polygalaceae | Polygala caudata | Ref. |
Plantae | Polygonaceae | Polygonum viscosum | Ref. |
Plantae | Polypodiaceae | Drynaria fortunei | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Putranjivaceae | Drypetes inaequalis | Ref. |
Plantae | Ranunculaceae | Nigella sativa | Ref. |
Plantae | Ranunculaceae | Pulsatilla cernua | Ref. |
Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
Plantae | Rosaceae | Spiraea formosana | Ref. |
Plantae | Rubiaceae | Adina pilulifera | Ref. |
Plantae | Rubiaceae | Hedyotis corymbosa | Ref. |
Plantae | Rubiaceae | Mitragyna inermis | Ref. |
Plantae | Rubiaceae | Mitragyna rotundifolia | Ref. |
Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
Plantae | Rubiaceae | Mitragyna stipulosa | Ref. |
Plantae | Rubiaceae | Morinda officinalis | Ref. |
Plantae | Rubiaceae | Morinda umbellata | Ref. |
Plantae | Rubiaceae | Mussaenda pubescens | Ref. |
Plantae | Rubiaceae | Oldenlandia diffusa | Ref. |
Plantae | Rubiaceae | Paederia foetida | Ref. |
Plantae | Rubiaceae | Psychotria serpens | Ref. |
Plantae | Rubiaceae | Rubia wallichiana DECNE | Ref. |
Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
Plantae | Ruppiaceae | Ruppia maritima | Ref. |
Plantae | Rutaceae | Atalantia buxifolia | Ref. |
Plantae | Rutaceae | Citrus tankan | Ref. |
Plantae | Rutaceae | Fagara heitzii | Ref. |
Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
Plantae | Rutaceae | Luvunga sarmentosa (Bl.) Kurz. | Ref. |
Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
Plantae | Rutaceae | Oriciopsis glaberrima ENGL. | Ref. |
Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Santalaceae | Scleropyrum wallichianum | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Sapindaceae | Dodonaea viscosa | Ref. |
Plantae | Sapindaceae | Schleichera trijuga | Ref. |
Plantae | Sapotaceae | Sebertia acuminata | Ref. |
Plantae | Scapaniaceae | Tritomaria quinquedentata (Huds.) | Ref. |
Plantae | Schistochilaceae | Schistochila glaucescens | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
Plantae | Solanaceae | Lycium chinense | Ref. |
Plantae | Solanaceae | Nicandra physaloides | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum chacoense Bitt. | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum melongena | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Stemonaceae | Stemona collinsae | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus cuspidata | Ref. |
Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
Plantae | Turneraceae | Turnera subulata | Ref. |
Plantae | Ulmaceae | Celtis laevigata | Ref. |
Plantae | Ulmaceae | Ulmus pervifolia | Ref. |
Plantae | Ulmaceae | Ulmus pumila | Ref. |
Plantae | Urticaceae | Boehmeria holosericea | Ref. |
Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
Plantae | Verbenaceae | Clerodendron cyrtophyllum | Ref. |
Plantae | Verbenaceae | Clerodendron neutens | Ref. |
Plantae | Verbenaceae | Clerodendron serratum | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
- | - | Asteracantha longifolia | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Changium smyrnioides | Ref. |
- | - | Chorisia insignis | Ref. |
- | - | Chorisia speciosa | Ref. |
- | - | Cyanara scolymus | Ref. |
- | - | Dictanopteris pedata | Ref. |
- | - | Dicteostelium discoideum | Ref. |
- | - | Dynamena pumila | Ref. |
- | - | Euphoria longan | Ref. |
- | - | Gleditsea sinensis | Ref. |
- | - | Lanurocerasus officinalis | Ref. |
- | - | Laurencia obtusa | Ref. |
- | - | Libanotis intermedia | Ref. |
- | - | Moghania strobilifera | Ref. |
- | - | Siegesbeckia orientalis | Ref. |
|
|
zoom in
Organism | Lactuca indica | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Mao, et al., APS, 31, (1996), 118.
Gu, et al., APS, 32, (1997), 59.
Feng, et al., CCMM, 19, (1994), 611.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wu, et al., Chem Pharm Bull, 53, (2005), 56.
Wu, et al., JNP, 64, (2001), 71.
Lin, et al., JNP, 64, (2001), 674.
Wu, et al., JNP, 64, (2001), 1040.
Jiang, et al., JNP, 64, (2001), 1266.
Block, et al., Phytochemistry, 65, (2004), 1165.
WU, et al., Chem Pharm Bull, 51, (2003), 948.
LIM, et al., Chem Pharm Bull, 53, (2005), 561.
CHAN, et al., Chem Pharm Bull, 53, (2005), 836.
LEU, et al., Chem Pharm Bull, 53, (2005), 853.
SUKSAMRARN, et al., Chem Pharm Bull, 53, (2005), 1327.
Liou, et al., JNP, 65, (2002), 1283.
Pan, et al., JNP, 66, (2003), 161.
Lan, et al., JNP, 66, (2003), 487.
Wu, et al., JNP, 66, (2003), 996.
Camacho, et al., Phytochemistry, 56, (2001), 203.
Chaturvedula, et al., Planta Med, 69, (2003), 271.
Lin, et al., Planta Med, 69, (2003), 757.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|