Name |
Cholesterol Cholesterin Cholest-5-en-3beta-ol |
Formula |
C27H46O |
Mw |
386.35486609 |
CAS RN |
57-88-5 |
C_ID |
C00003648
,
|
InChIKey |
HVYWMOMLDIMFJA-ZMWIUTBPNA-N |
InChICode |
InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
SMILES |
C1[C@@H](CC2=CC[C@@H]3[C@@H]([C@]2(C1)C)CC[C@]1([C@H]3CC[C@@H]1[C@@H](CCCC(C)C)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
-- | Amoebidiidae | Amoebidium parasiticum | Ref. |
Animalia | Drepanidae | Achlya bisexualis | Ref. |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Chromalveolata | Pelagophyceae | Aureoumbra lagunensis | Ref. |
Fungi | Acaulosporaceae | Acaulospora laevis | Ref. |
Fungi | Blastocladiaceae | Allomyces macrogynus | Ref. |
Fungi | Blastocladiaceae | Allomyces spp. | Ref. |
Fungi | Glomeraceae | Glomus mosseae | Ref. |
Fungi | Glomeraceae | Glomus sp. | Ref. |
Fungi | Gnomoniaceae | Gnomonia leptostyla | Ref. |
Fungi | Hypocreaceae | Nectria galligena | Ref. |
Fungi | Phaeosphaeriaceae | Leptosphaeria typhae | Ref. |
Fungi | Phycomycetaceae | Phycomyces blakesleeanus | Ref. |
Fungi | Trichocomaceae | Aspergillus oryzae | Ref. |
Plantae | Asphodelaceae | Aloe barbadensis | Ref. |
Plantae | Asteraceae | Conyza aegyptica | Ref. |
Plantae | Burseraceae | Commiphora mukul | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Brassica rapa | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cruciferae | Erysimum carniolicum | Ref. |
Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
Plantae | Dioscoreaceae | Dioscorea zingiberensis | Ref. |
Plantae | Fabaceae | Bauhinia candicans | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Prosopis spicigera | Ref. |
Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
Plantae | Hydrocharitaceae | Halophila ovalis | Ref. |
Plantae | Hydrocharitaceae | Halophila ovata | Ref. |
Plantae | Hydrocharitaceae | Halophila spinulosa | Ref. |
Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Laminariaceae | Laminaria japonica | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Hibiscus sabdariffa L. | Ref. |
Plantae | Malvaceae | Malva parviflora | Ref. |
Plantae | Melanthiaceae | Veratrum grandiflorum | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Palmae | Phoenix dactylifera | Ref. |
Plantae | Plantaginaceae | Digitalis lanata Ehrh. | Ref. |
Plantae | Poaceae | Hordeum vulgare L.cv Mammut | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Ranunculaceae | Nigella sativa | Ref. |
Plantae | Rutaceae | Haplophyllum acutifolium | Ref. |
Plantae | Sapindaceae | Schleichera trijuga | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana | Ref. |
Plantae | Solanaceae | Solanum chacoense | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Verbenaceae | Clerodendron neutens | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
- | - | Blastocladia ramosa | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Chattonella marina | Ref. |
- | - | Chloromorum toxicum | Ref. |
- | - | Chorisia insignis | Ref. |
- | - | Chorisia speciosa | Ref. |
- | - | Collectotrichum dematium | Ref. |
- | - | Crotone hieronymi | Ref. |
- | - | Dipsacomyces acuminosporus | Ref. |
- | - | Dynamena pumila | Ref. |
- | - | Furcellaria fastigiata | Ref. |
- | - | Hyrtios gumminae | Ref. |
- | - | Lanurocerasus officinalis | Ref. |
- | - | Laurencia aldingensis | Ref. |
- | - | Linderina pennispora | Ref. |
- | - | Monoblepharella sp. | Ref. |
- | - | Rhizophlyctis rosea | Ref. |
- | - | Smittium sp. | Ref. |
- | - | Ustilago maydis | Ref. |
|
|
zoom in
Organism | Aspergillus oryzae | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids,Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II,Academic Press,New York,NY,631 pp.(1983) |
---|
|