Name |
Camazulene Chamazulene |
Formula |
C14H16 |
Mw |
184.12520051 |
CAS RN |
529-05-5 |
C_ID |
C00003114
,
|
InChIKey |
GXGJIOMUZAGVEH-UHFFFAOYSA-N |
InChICode |
InChI=1S/C14H16/c1-4-12-7-5-10(2)13-8-6-11(3)14(13)9-12/h5-9H,4H2,1-3H3 |
SMILES |
c12c(cc(ccc1C)CC)c(cc2)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achillea alpina | Ref. |
Plantae | Asteraceae | Achillea millefolium | Ref. |
Plantae | Asteraceae | Achillea moschata | Ref. |
Plantae | Asteraceae | Artemisia absinthium | Ref. |
Plantae | Asteraceae | Artemisia spp. | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Chamomilla rectita | Ref. |
Plantae | Asteraceae | Chamomilla recutina | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Labiatae | Nepeta leucophylla | Ref. |
Plantae | Lauraceae | Lindera strychnifolia | Ref. |
Plantae | Pinaceae | Pinus eldarica | Ref. |
Plantae | Pinaceae | Pinus kochiana | Ref. |
Plantae | Pinaceae | Pinus pallasiana | Ref. |
Plantae | Pinaceae | Pinus sosnowskyi | Ref. |
Plantae | Pinaceae | Pinus sylvestris L.var.sylvestris. | Ref. |
Plantae | Rutaceae | Skimmia laureola | Ref. |
- | - | Achillea | Ref. |
- | - | Achillea,Artemisia spp. | Ref. |
- | - | Chamaemalum nobile | Ref. |
|
|
zoom in
Organism | Chamomilla rectita | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|