Name |
3-O-Caffeoylquinic acid Chlorogenic acid Chlorogenate Heriguard Caffeoylquinic acid |
Formula |
C16H18O9 |
Mw |
354.09508217 |
CAS RN |
327-97-9 |
C_ID |
C00002724
,
|
InChIKey |
CWVRJTMFETXNAD-PCEXOASVNA-N |
InChICode |
InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 |
SMILES |
O[C@]1(C[C@H]([C@H]([C@@H](C1)OC(=O)/C=C/c1ccc(c(c1)O)O)O)O)C(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera confusa | Ref. |
Plantae | -- | Lonicera fulvotomentosa | Ref. |
Plantae | -- | Lonicera hypoglauca | Ref. |
Plantae | -- | Lonicera implexa | Ref. |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | -- | Lonicera similis | Ref. |
Plantae | Acanthaceae | Andrographis paniculata | Ref. |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Adoxaceae | Sambucus formosana | Ref. |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Chaerophyllum hirsutum | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Glehnia littoralis | Ref. |
Plantae | Apocynaceae | Marsdenia cundurango | Ref. |
Plantae | Apocynaceae | Nerium oleander | Ref. |
Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Achillea millefolium | Ref. |
Plantae | Asteraceae | Anthemis altissima | Ref. |
Plantae | Asteraceae | Arctium lappa | Ref. |
Plantae | Asteraceae | Arnica montana cv.ARBO | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Asteraceae | Artemisia herba-alba | Ref. |
Plantae | Asteraceae | Artemisia scoparia. | Ref. |
Plantae | Asteraceae | Aster salignus | Ref. |
Plantae | Asteraceae | Centaurea gigantea | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Chrysanthemum indicum | Ref. |
Plantae | Asteraceae | Chrysanthemum indicum L. | Ref. |
Plantae | Asteraceae | Chrysanthemum morifolium | Ref. |
Plantae | Asteraceae | Cirsium setosum | Ref. |
Plantae | Asteraceae | Helianthus annuus L.cv.Peredovick | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Lactuca indica | Ref. |
Plantae | Asteraceae | Leontodon autumnalis | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Onopordum acanthium | Ref. |
Plantae | Asteraceae | Pterocaulon virgatum | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Scorzonera divaricata | Ref. |
Plantae | Asteraceae | Senecio nemorensis | Ref. |
Plantae | Asteraceae | Solidago altissima L. | Ref. |
Plantae | Asteraceae | Solidago canadensis | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Asteraceae | Taraxacum mongolicum | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Berberidaceae | Epimedium koreanum | Ref. |
Plantae | Berberidaceae | Epimedium sagittatum | Ref. |
Plantae | Blechnaceae | Blechnum orientale | Ref. |
Plantae | Boraginaceae | Cordia macleodii | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllales | Beta vulgaris | Ref. |
Plantae | Chloranthaceae | Sarcandra glabra | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia jasminoides | Ref. |
Plantae | Commelinaceae | Commelina communis | Ref. |
Plantae | Convolvulaceae | Erycibe schimidtii | Ref. |
Plantae | Convolvulaceae | Ipomoea nil | Ref. |
Plantae | Convolvulaceae | Ipomoea njil cv. Danjuro | Ref. |
Plantae | Cruciferae | Brassica oleracea var.capitata | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
Plantae | Ericaceae | Rhododendron fortunei | Ref. |
Plantae | Ericaceae | Rhododendron insigne | Ref. |
Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
Plantae | Ericaceae | Rhododendron micranthum | Ref. |
Plantae | Ericaceae | Rhododendron oreotrephes | Ref. |
Plantae | Ericaceae | Rhododendron ponticum | Ref. |
Plantae | Ericaceae | Rhododendron praevernum | Ref. |
Plantae | Ericaceae | Rhododendron sp. | Ref. |
Plantae | Eucommiaceae | Eucommia ulmoides Oliver | Ref. |
Plantae | Fabaceae | Acacia nilotica | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Peltophorum africanum | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Trifolium alpestre | Ref. |
Plantae | Fabaceae | Trifolium medium | Ref. |
Plantae | Fabaceae | Trifolium pratense L. | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Fumariaceae | Fumaria officinalis | Ref. |
Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
Plantae | Fumariaceae | Fumaria vaillantii | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hamamelidaceae | Loropetalum chinense | Ref. |
Plantae | Hypericaceae | Hypericum perforatum | Ref. |
Plantae | Labiatae | Orthosiphon stamineus | Ref. |
Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
Plantae | Labiatae | Salvia albimaculata | Ref. |
Plantae | Labiatae | Salvia horminum | Ref. |
Plantae | Labiatae | Salvia officinalis L. | Ref. |
Plantae | Labiatae | Salvia triloba | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Sideritis catillaris | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus comosus | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lardizabalaceae | Sargentodoxa cuneata | Ref. |
Plantae | Longaniaceae | Strychnos colubrina | Ref. |
Plantae | Longaniaceae | Strychnos lucida | Ref. |
Plantae | Longaniaceae | Strychnos nux-vomica | Ref. |
Plantae | Lythraceae | Lythrum salicaria | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Malvaceae | Gossypium barbadense | Ref. |
Plantae | Malvaceae | Theobroma cacao | Ref. |
Plantae | Meliaceae | Toona ciliata | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Musaceae | Musa acuminata | Ref. |
Plantae | Myrtaceae | Eugenia jambolana | Ref. |
Plantae | Onocleaceae/Dryopteridaceae | Matteuccia struthiopteris | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Phyllanthaceae | Phyllanthus sellowianus | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Plantaginaceae | Plantago bellardi | Ref. |
Plantae | Plantaginaceae | Plantago cretica | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Veronica montana | Ref. |
Plantae | Plantaginaceae | Veronica officinalis | Ref. |
Plantae | Plantaginaceae | Veronica orchidea | Ref. |
Plantae | Plantaginaceae | Veronica polita | Ref. |
Plantae | Plantaginaceae | Veronica spuria | Ref. |
Plantae | Plantaginaceae | Veronica teucrium | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
Plantae | Polygonaceae | Fagopyrum cymosum | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Polygonaceae | Polygonum bistorta | Ref. |
Plantae | Polypodiaceae | Polypodium vulgare | Ref. |
Plantae | Polypodiaceae | Pyrrosia davidii | Ref. |
Plantae | Polypodiaceae | Pyrrosia drakeana | Ref. |
Plantae | Polypodiaceae | Pyrrosia gralla | Ref. |
Plantae | Polypodiaceae | Pyrrosia lingua | Ref. |
Plantae | Polypodiaceae | Pyrrosia petiolosa | Ref. |
Plantae | Polypodiaceae | Pyrrosia pseudocalvata | Ref. |
Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Primulaceae | Primula veris | Ref. |
Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis | Ref. |
Plantae | Resedaceae | Reseda muricata C.Presl. | Ref. |
Plantae | Rosaceae | Cotoneaster simonsii | Ref. |
Plantae | Rosaceae | Crataegus cuneata | Ref. |
Plantae | Rosaceae | Crataegus oxyacantha | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida var.major | Ref. |
Plantae | Rosaceae | Eriobotrya japonica | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus cerasus | Ref. |
Plantae | Rosaceae | Prunus mume | Ref. |
Plantae | Rubiaceae | Adina racemosa | Ref. |
Plantae | Rubiaceae | Coffea arabica | Ref. |
Plantae | Rubiaceae | Galium verum | Ref. |
Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
Plantae | Sapindaceae | Dodonaea viscosa | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saxifragaceae | Saxifraga azizoon | Ref. |
Plantae | Solanaceae | Brunfelsia grandiflora D.DON | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum acaule | Ref. |
Plantae | Solanaceae | Solanum bulbocastanum | Ref. |
Plantae | Solanaceae | Solanum canasense | Ref. |
Plantae | Solanaceae | Solanum cardiophyllum | Ref. |
Plantae | Solanaceae | Solanum chacoense | Ref. |
Plantae | Solanaceae | Solanum commersonii | Ref. |
Plantae | Solanaceae | Solanum fendleri | Ref. |
Plantae | Solanaceae | Solanum habrochaites | Ref. |
Plantae | Solanaceae | Solanum hougasii | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum multidissectum | Ref. |
Plantae | Solanaceae | Solanum neorickii | Ref. |
Plantae | Solanaceae | Solanum nigrum | Ref. |
Plantae | Solanaceae | Solanum parviflorum | Ref. |
Plantae | Solanaceae | Solanum pennellii | Ref. |
Plantae | Solanaceae | Solanum phureja | Ref. |
Plantae | Solanaceae | Solanum pimpinellifollium | Ref. |
Plantae | Solanaceae | Solanum pinnacritisectum | Ref. |
Plantae | Solanaceae | Solanum stoloniferum | Ref. |
Plantae | Solanaceae | Solanum tarijense | Ref. |
Plantae | Solanaceae | Solanum tuberosum L. | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Theaceae | Thea sinensis | Ref. |
Plantae | Turneraceae | Turnera ulmifolia | Ref. |
Plantae | Urticaceae | Urtica dioica | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansii | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana prionophylla | Ref. |
Plantae | Verbenaceae | Stachytarpheta jamaicensis | Ref. |
Plantae | Verbenaceae | Verbena officinalis | Ref. |
Plantae | Zingiberaceae | Etlingera elatior | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Apiaceae | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Paraburkholderia phymatum | Ref. |
- | - | Platyphora ligata | Ref. |
- | - | Stachytapheta jamaicensis | Ref. |
|
|
zoom in
Organism | Taraxacum formosanum | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Chaubal, et al., Planta Med, 69, (2003), 287.
Zidorn, et al., Phytochemistry, 66, (2005), 1691.
Kirmizibekmez, et al., Planta Med, 70, (2004), 711.
Mao, et al., Zhongguo Yaowu Huaxue Zazhi, 14, (2004), 326.
Itoh, et al., Journal of Natural Products, 66, (2003), 1212.
Yoshikawa, et al., Journal of Natural Products, 65, (2002), 1151.
Hou, et al., Journal of Natural Products, 66, (2003), 625.
KITAJIMA, et al., Chem Pharm Bull, 53, (2005), 1355.
YUAN, et al., Chem Pharm Bull, 50, (2002), 73.
Kimura, et al., Phytochemistry, 65, (2004), 423.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Song, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 359.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Ling, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 232.
Huang, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 247. |
---|
|