Name |
Gallic acid Gallate Gallic acid monohydrate |
Formula |
C7H6O5 |
Mw |
170.0215233 |
CAS RN |
149-91-7 |
C_ID |
C00002647
,
|
InChIKey |
LNTHITQWFMADLM-UHFFFAOYSA-N |
InChICode |
InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12) |
SMILES |
c1(c(cc(cc1O)C(=O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Adoxaceae | Sambucus formosana | Ref. |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Choerospondias axillaris | Ref. |
Plantae | Anacardiaceae | Cotinus coggygria | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Pistacia chinensis | Ref. |
Plantae | Anacardiaceae | Pistacia weinmannifolia J.Pisson ex.Franch | Ref. |
Plantae | Anacardiaceae | Rhus chinensis | Ref. |
Plantae | Anacardiaceae | Rhus coriaria | Ref. |
Plantae | Anacardiaceae | Rhus semialata | Ref. |
Plantae | Anacardiaceae | Rhus typhina | Ref. |
Plantae | Anacardiaceae | Rhus wallichi | Ref. |
Plantae | Anacardiaceae | Semecarpus vitiensis | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Peucedanum praeruptorum | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Tussilago farfara | Ref. |
Plantae | Balanophoraceae | Balanophora japonica | Ref. |
Plantae | Bignoniaceae | Paratecoma peroba | Ref. |
Plantae | Burseraceae | Boswellia dalzielii | Ref. |
Plantae | Burseraceae | Canarium album | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia densivenia | Ref. |
Plantae | Clusiaceae-Guttiferae | Allanblackia floribunda | Ref. |
Plantae | Combretaceae | Combretum quadrangulare | Ref. |
Plantae | Combretaceae | Terminalia chebula | Ref. |
Plantae | Combretaceae | Terminalia fagifolia | Ref. |
Plantae | Combretaceae | Terminalia superba | Ref. |
Plantae | Convolvulaceae | Pharbitis nil | Ref. |
Plantae | Coriariaceae | Coriaria sinica | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
Plantae | Crassulaceae | Rhodiola kirilowii | Ref. |
Plantae | Crassulaceae | Rhodiola rosea | Ref. |
Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
Plantae | Crassulaceae | Sedum takesimense Nakai | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Cucurbitaceae | Lagenaria indica | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cunoniaceae | Cunonia macrophylla | Ref. |
Plantae | Cymodoceaceae | Amphibolis antarctica | Ref. |
Plantae | Cymodoceaceae | Cymodocea rotundata | Ref. |
Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
Plantae | Cymodoceaceae | Thalassodendron ciliatum | Ref. |
Plantae | Dilleniaceae | Dillenia indica | Ref. |
Plantae | Ebenaceae | Diospyros cinnabarina | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ericaceae | Pyrola calliantha | Ref. |
Plantae | Euphorbiaceae | Croton tonkinensis GAGNEP | Ref. |
Plantae | Euphorbiaceae | Euphorbia humifusa | Ref. |
Plantae | Euphorbiaceae | Euphorbia lunulata | Ref. |
Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis | Ref. |
Plantae | Euphorbiaceae | Macaranga barteri | Ref. |
Plantae | Euphorbiaceae | Mallotus furetianus | Ref. |
Plantae | Euphorbiaceae | Sapium sebifenum | Ref. |
Plantae | Euphorbiaceae | Sapium sebiferum | Ref. |
Plantae | Fabaceae | Abrus precatorius | Ref. |
Plantae | Fabaceae | Acacia arabica | Ref. |
Plantae | Fabaceae | Acacia cyanophylla | Ref. |
Plantae | Fabaceae | Acacia farnesiana | Ref. |
Plantae | Fabaceae | Acacia horrida | Ref. |
Plantae | Fabaceae | Acacia longifolia | Ref. |
Plantae | Fabaceae | Acacia mellifera | Ref. |
Plantae | Fabaceae | Acacia nilotica | Ref. |
Plantae | Fabaceae | Acacia polyacantha subsp.camphylacantha | Ref. |
Plantae | Fabaceae | Acacia saligna | Ref. |
Plantae | Fabaceae | Acacia seyal | Ref. |
Plantae | Fabaceae | Acacia sieberiana | Ref. |
Plantae | Fabaceae | Acacia tortilis | Ref. |
Plantae | Fabaceae | Caesalpinia mimosoides | Ref. |
Plantae | Fabaceae | Caesalpinia pulcherrima | Ref. |
Plantae | Fabaceae | Caesalpinia sappan | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Fabaceae | Peltophorum africanum | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fagaceae | Quercus alba | Ref. |
Plantae | Fagaceae | Quercus infectoria | Ref. |
Plantae | Fagaceae | Quercus robur | Ref. |
Plantae | Geraniaceae | Geranium macrorrhizum L. | Ref. |
Plantae | Geraniaceae | Geranium pratense | Ref. |
Plantae | Geraniaceae | Geranium sibiricum | Ref. |
Plantae | Geraniaceae | Geranium thunbergii | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hamamelidaceae | Hamamelis virginiana | Ref. |
Plantae | Hamamelidaceae | Loropetalum chinense | Ref. |
Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
Plantae | Hydrocharitaceae | Halophila minor | Ref. |
Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Juglandaceae | Juglans mandshurica | Ref. |
Plantae | Juglandaceae | Juglans regia | Ref. |
Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
Plantae | Labiatae | Origanum acutidens | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Loranthaceae | Psittacanthus cucullaris | Ref. |
Plantae | Lythraceae | Lawsonia inermis | Ref. |
Plantae | Lythraceae | Lythrum salicaria | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Melastomataceae | Melastoma intermedium | Ref. |
Plantae | Melastomataceae | Miconia cabucu | Ref. |
Plantae | Melastomataceae | Miconia myriantha | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Meliaceae | Toona ciliata | Ref. |
Plantae | Meliaceae | Toona sinensis | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myricaceae | Myrica rubra | Ref. |
Plantae | Myrsinaceae | Ardisia colorata | Ref. |
Plantae | Myrtaceae | Eucalyptus robusta | Ref. |
Plantae | Myrtaceae | Eugenia edulis | Ref. |
Plantae | Myrtaceae | Eugenia jambolana | Ref. |
Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
Plantae | Myrtaceae | Pimenta dioica | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Myrtaceae | Syzygium cordatum | Ref. |
Plantae | Myrtaceae | Syzygium cumini | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Nymphaeaceae | Nymphaea stellata | Ref. |
Plantae | Onagraceae | Epilobium hirsutum | Ref. |
Plantae | Paeoniaceae | Paeonia albiflora | Ref. |
Plantae | Paeoniaceae | Paeonia emodi | Ref. |
Plantae | Paeoniaceae | Paeonia mouton | Ref. |
Plantae | Palmae | Trachycarpus fortunei | Ref. |
Plantae | Passifloraceae | Passiflora caerulea | Ref. |
Plantae | Phyllanthaceae | Bridelia micrantha | Ref. |
Plantae | Phyllanthaceae | Emblica officinalis | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Phyllanthaceae | Phyllanthus niruri | Ref. |
Plantae | Phyllanthaceae | Phyllanthus urinaria | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Pseudolarix kaempferi Gord. | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Polygonaceae | Polygonum bistorta | Ref. |
Plantae | Polygonaceae | Polygonum cuspidatum | Ref. |
Plantae | Polygonaceae | Polygonum equiseiforme | Ref. |
Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
Plantae | Polygonaceae | Polygonum multiflorum | Ref. |
Plantae | Polygonaceae | Polygonum orientale | Ref. |
Plantae | Polygonaceae | Rheum emodii | Ref. |
Plantae | Polygonaceae | Rheum hotaoense | Ref. |
Plantae | Polygonaceae | Rheum officinale | Ref. |
Plantae | Polygonaceae | Rheum palmatum | Ref. |
Plantae | Polygonaceae | Rheum tanguticum | Ref. |
Plantae | Polygonaceae | Rumex thyrsiflorus | Ref. |
Plantae | Posidoniaceae | Posidonia australis | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rosaceae | Agrimonia pilosa var.japonica | Ref. |
Plantae | Rosaceae | Cowania mexicana | Ref. |
Plantae | Rosaceae | Potentilla chinense | Ref. |
Plantae | Rosaceae | Rosa chinensis | Ref. |
Plantae | Rosaceae | Rosa rugosa | Ref. |
Plantae | Rosaceae | Sanguisorba officinalis | Ref. |
Plantae | Rubiaceae | Uncaria gambir | Ref. |
Plantae | Sapindaceae | Acer rubrum L. | Ref. |
Plantae | Sapotaceae | Manilkara zapota cv.Tikal | Ref. |
Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Tamaricaceae | Tamarix chinensis | Ref. |
Plantae | Tamaricaceae | Tamarix nilotica | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Turneraceae | Turnera ulmifolia | Ref. |
Plantae | Typhaceae | Typha domingensis P. | Ref. |
Plantae | Urticaceae | Debregeasia longifolia | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Vitaceae | Ampelopsis japonica | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zosteraceae | Phyllospadix scouleri | Ref. |
Plantae | Zosteraceae | Phyllospadix serrulatus | Ref. |
Plantae | Zosteraceae | Zostera capricorni | Ref. |
Plantae | Zosteraceae | Zostera marina | Ref. |
Plantae | Zosteraceae | Zostera muelleri | Ref. |
- | - | Chamaenerion angustifolium | Ref. |
- | - | Equsetum arvense | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Haematoxylon campechianum | Ref. |
- | - | Paraburkholderia phymatum | Ref. |
- | - | Rohdiola sacra | Ref. |
- | - | Sarcolaeana multiflora | Ref. |
- | - | Terminala chebula | Ref. |
- | - | terminalia bellirica | Ref. |
|
|
zoom in
Organism | Moringa oleifera | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|