Name |
Genistein Prunetol Sophoricol Genisteol Differenol A 5,7,4'-Trihydroxyisoflavone |
Formula |
C15H10O5 |
Mw |
270.05282343 |
CAS RN |
446-72-0 |
C_ID |
C00002526
,
|
InChIKey |
TZBJGXHYKVUXJN-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
SMILES |
c1(cc(c2c(c1)occ(c2=O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Apiaceae | Bupleurum scorzonerifolium | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
Plantae | Fabaceae | Acacia adunca | Ref. |
Plantae | Fabaceae | Acacia baileyana | Ref. |
Plantae | Fabaceae | Acacia binervata | Ref. |
Plantae | Fabaceae | Acacia calamifolia | Ref. |
Plantae | Fabaceae | Acacia cardiophylla | Ref. |
Plantae | Fabaceae | Acacia chrysotricha | Ref. |
Plantae | Fabaceae | Acacia clunies-rossiae | Ref. |
Plantae | Fabaceae | Acacia concurrens | Ref. |
Plantae | Fabaceae | Acacia constablei | Ref. |
Plantae | Fabaceae | Acacia cultriformis | Ref. |
Plantae | Fabaceae | Acacia dealbata | Ref. |
Plantae | Fabaceae | Acacia deanei | Ref. |
Plantae | Fabaceae | Acacia decurrens | Ref. |
Plantae | Fabaceae | Acacia elata | Ref. |
Plantae | Fabaceae | Acacia falciformis | Ref. |
Plantae | Fabaceae | Acacia filicifolia | Ref. |
Plantae | Fabaceae | Acacia fimbriata | Ref. |
Plantae | Fabaceae | Acacia holosericea | Ref. |
Plantae | Fabaceae | Acacia irrorata | Ref. |
Plantae | Fabaceae | Acacia kettlewelliae | Ref. |
Plantae | Fabaceae | Acacia lanigera | Ref. |
Plantae | Fabaceae | Acacia leucoclada | Ref. |
Plantae | Fabaceae | Acacia longifolia | Ref. |
Plantae | Fabaceae | Acacia mabellae | Ref. |
Plantae | Fabaceae | Acacia mearnsii | Ref. |
Plantae | Fabaceae | Acacia melanoxylon | Ref. |
Plantae | Fabaceae | Acacia mollifolia | Ref. |
Plantae | Fabaceae | Acacia neriifolia | Ref. |
Plantae | Fabaceae | Acacia obtusifolia | Ref. |
Plantae | Fabaceae | Acacia oshanesii | Ref. |
Plantae | Fabaceae | Acacia oswaldii | Ref. |
Plantae | Fabaceae | Acacia parramattensis | Ref. |
Plantae | Fabaceae | Acacia pycnantha | Ref. |
Plantae | Fabaceae | Acacia retinodes | Ref. |
Plantae | Fabaceae | Acacia rigens | Ref. |
Plantae | Fabaceae | Acacia silvestris | Ref. |
Plantae | Fabaceae | Acacia terminalis | Ref. |
Plantae | Fabaceae | Acacia trachyphloia | Ref. |
Plantae | Fabaceae | Acacia verniciflua | Ref. |
Plantae | Fabaceae | Acacia vestita | Ref. |
Plantae | Fabaceae | Adenocarpus decorticans | Ref. |
Plantae | Fabaceae | Adenocarpus foliolosus | Ref. |
Plantae | Fabaceae | Amphicarpaea bracteata | Ref. |
Plantae | Fabaceae | Andira inermis | Ref. |
Plantae | Fabaceae | Apios americana | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Baptisia alba | Ref. |
Plantae | Fabaceae | Baptisia australis | Ref. |
Plantae | Fabaceae | Baptisia bracteata | Ref. |
Plantae | Fabaceae | Baptisia calycosa | Ref. |
Plantae | Fabaceae | Baptisia cinerea | Ref. |
Plantae | Fabaceae | Baptisia lanceolata | Ref. |
Plantae | Fabaceae | Baptisia lecontei | Ref. |
Plantae | Fabaceae | Baptisia megacarpa | Ref. |
Plantae | Fabaceae | Baptisia nuttalliana | Ref. |
Plantae | Fabaceae | Baptisia perfoliata | Ref. |
Plantae | Fabaceae | Baptisia tinctoria | Ref. |
Plantae | Fabaceae | Bowdichia nitida | Ref. |
Plantae | Fabaceae | Cajanus cajan | Ref. |
Plantae | Fabaceae | Cajanus scarabaeoides | Ref. |
Plantae | Fabaceae | Calicotome spinosa | Ref. |
Plantae | Fabaceae | Calicotome villosa | Ref. |
Plantae | Fabaceae | Calopogonium caeruleum | Ref. |
Plantae | Fabaceae | Camptosema rubicundum | Ref. |
Plantae | Fabaceae | Canavalia eurycarpa | Ref. |
Plantae | Fabaceae | Canavalia gladiata | Ref. |
Plantae | Fabaceae | Cicer arietinum | Ref. |
Plantae | Fabaceae | Clitoria falcata | Ref. |
Plantae | Fabaceae | Clitoria ternatea | Ref. |
Plantae | Fabaceae | Crotalaria juncea | Ref. |
Plantae | Fabaceae | Cytisus albus | Ref. |
Plantae | Fabaceae | Cytisus baeticus | Ref. |
Plantae | Fabaceae | Cytisus commutatus | Ref. |
Plantae | Fabaceae | Cytisus fontanesii | Ref. |
Plantae | Fabaceae | Cytisus proliferus | Ref. |
Plantae | Fabaceae | Cytisus ratisbonensis | Ref. |
Plantae | Fabaceae | Cytisus scoparius | Ref. |
Plantae | Fabaceae | Cytisus striatus | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Derris scandens | Ref. |
Plantae | Fabaceae | Desmodium gangeticum | Ref. |
Plantae | Fabaceae | Desmodium uncinatum | Ref. |
Plantae | Fabaceae | Dipogon lignosus | Ref. |
Plantae | Fabaceae | Dunbaria villosa | Ref. |
Plantae | Fabaceae | Echinosophora koreensis | Ref. |
Plantae | Fabaceae | Echinospartum horridum | Ref. |
Plantae | Fabaceae | Erinacea anthyllis | Ref. |
Plantae | Fabaceae | Eriosema glomeratum | Ref. |
Plantae | Fabaceae | Eriosema nutans | Ref. |
Plantae | Fabaceae | Eriosema psoraleoides | Ref. |
Plantae | Fabaceae | Erythrina burttii | Ref. |
Plantae | Fabaceae | Erythrina indica | Ref. |
Plantae | Fabaceae | Erythrina latissima | Ref. |
Plantae | Fabaceae | Euchresta formosana | Ref. |
Plantae | Fabaceae | Flemingia macrophylla | Ref. |
Plantae | Fabaceae | Flemingia philippinensis | Ref. |
Plantae | Fabaceae | Flemingia stricta | Ref. |
Plantae | Fabaceae | Flemingia strobilifera | Ref. |
Plantae | Fabaceae | Galactia jussiaeana | Ref. |
Plantae | Fabaceae | Genista acanthoclada | Ref. |
Plantae | Fabaceae | Genista albida | Ref. |
Plantae | Fabaceae | Genista anglica | Ref. |
Plantae | Fabaceae | Genista canariensis | Ref. |
Plantae | Fabaceae | Genista cupanii | Ref. |
Plantae | Fabaceae | Genista depressa | Ref. |
Plantae | Fabaceae | Genista ephedroides | Ref. |
Plantae | Fabaceae | Genista hispanica | Ref. |
Plantae | Fabaceae | Genista hystrix | Ref. |
Plantae | Fabaceae | Genista linifolia | Ref. |
Plantae | Fabaceae | Genista lobelii | Ref. |
Plantae | Fabaceae | Genista microphylla | Ref. |
Plantae | Fabaceae | Genista monspessulana | Ref. |
Plantae | Fabaceae | Genista morisii | Ref. |
Plantae | Fabaceae | Genista obtusiramea | Ref. |
Plantae | Fabaceae | Genista pulchella | Ref. |
Plantae | Fabaceae | Genista radiata | Ref. |
Plantae | Fabaceae | Genista sagittalis | Ref. |
Plantae | Fabaceae | Genista salzmannii | Ref. |
Plantae | Fabaceae | Genista scorpius | Ref. |
Plantae | Fabaceae | Genista sericea | Ref. |
Plantae | Fabaceae | Genista sessilifolia | Ref. |
Plantae | Fabaceae | Genista spartioides | Ref. |
Plantae | Fabaceae | Genista stenopetala | Ref. |
Plantae | Fabaceae | Genista subcapitata | Ref. |
Plantae | Fabaceae | Genista tinctoria | Ref. |
Plantae | Fabaceae | Genista triacanthos | Ref. |
Plantae | Fabaceae | Genista tridens | Ref. |
Plantae | Fabaceae | Genista tridentata | Ref. |
Plantae | Fabaceae | Genista ulicina | Ref. |
Plantae | Fabaceae | Glycine canescens | Ref. |
Plantae | Fabaceae | Glycine clandestina | Ref. |
Plantae | Fabaceae | Glycine falcata | Ref. |
Plantae | Fabaceae | Glycine latifolia | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycine tabacina | Ref. |
Plantae | Fabaceae | Glycine tomentella | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Hardenbergia violacea | Ref. |
Plantae | Fabaceae | Kennedia coccinea | Ref. |
Plantae | Fabaceae | Kennedia nigricans | Ref. |
Plantae | Fabaceae | Kennedia procurrens | Ref. |
Plantae | Fabaceae | Kennedia rubicunda | Ref. |
Plantae | Fabaceae | Lablab purpureus | Ref. |
Plantae | Fabaceae | Laburnum anagyroides | Ref. |
Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
Plantae | Fabaceae | Lespedeza juncea | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Lupinus arboreus | Ref. |
Plantae | Fabaceae | Lupinus arcticus | Ref. |
Plantae | Fabaceae | Lupinus elegans | Ref. |
Plantae | Fabaceae | Lupinus luteus | Ref. |
Plantae | Fabaceae | Lupinus mutabilis | Ref. |
Plantae | Fabaceae | Lupinus nanus | Ref. |
Plantae | Fabaceae | Lupinus pilosus | Ref. |
Plantae | Fabaceae | Lupinus sericeus | Ref. |
Plantae | Fabaceae | Lupinus subcarnosus | Ref. |
Plantae | Fabaceae | Lupinus texensis | Ref. |
Plantae | Fabaceae | Maackia amurensis | Ref. |
Plantae | Fabaceae | Macroptilium bracteatum | Ref. |
Plantae | Fabaceae | Macroptilium lathyroides | Ref. |
Plantae | Fabaceae | Macroptilium martii | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Millettia dielsiana | Ref. |
Plantae | Fabaceae | Mucuna pruriens | Ref. |
Plantae | Fabaceae | Neonotonia wightii | Ref. |
Plantae | Fabaceae | Neorautanenia amboensis | Ref. |
Plantae | Fabaceae | Ononis spinosa | Ref. |
Plantae | Fabaceae | Ormosia monosperma | Ref. |
Plantae | Fabaceae | Otholobium bolusii | Ref. |
Plantae | Fabaceae | Otholobium bracteolatum | Ref. |
Plantae | Fabaceae | Otholobium candicans | Ref. |
Plantae | Fabaceae | Otholobium hirtum | Ref. |
Plantae | Fabaceae | Otholobium spicatum | Ref. |
Plantae | Fabaceae | Otholobium striatum | Ref. |
Plantae | Fabaceae | Otholobium uncinatum | Ref. |
Plantae | Fabaceae | Otholobium wilmsii | Ref. |
Plantae | Fabaceae | Pericopsis laxiflora | Ref. |
Plantae | Fabaceae | Phaseolus coccineus | Ref. |
Plantae | Fabaceae | Phaseolus lunatus | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Pseudeminia comosa | Ref. |
Plantae | Fabaceae | Pseudoeriosema borianii | Ref. |
Plantae | Fabaceae | Pseudovigna argentea | Ref. |
Plantae | Fabaceae | Psoralea aculeata | Ref. |
Plantae | Fabaceae | Psoralea arborea | Ref. |
Plantae | Fabaceae | Psoralea axillaris | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Psoralea effusa | Ref. |
Plantae | Fabaceae | Psoralea fascicularis | Ref. |
Plantae | Fabaceae | Psoralea laxa | Ref. |
Plantae | Fabaceae | Psoralea oligophylla | Ref. |
Plantae | Fabaceae | Psoralea repens | Ref. |
Plantae | Fabaceae | Pterocarpus angolensis | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium | Ref. |
Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
Plantae | Fabaceae | Pueraria lobata | Ref. |
Plantae | Fabaceae | Pueraria mirifica | Ref. |
Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
Plantae | Fabaceae | Pueraria phaseoloides | Ref. |
Plantae | Fabaceae | Pueraria tuberosa | Ref. |
Plantae | Fabaceae | Retama monosperma | Ref. |
Plantae | Fabaceae | Retama raetam | Ref. |
Plantae | Fabaceae | Rhynchosia caribaea | Ref. |
Plantae | Fabaceae | Rhynchosia densiflora | Ref. |
Plantae | Fabaceae | Rhynchosia hirsuta | Ref. |
Plantae | Fabaceae | Rhynchosia phaseoloides | Ref. |
Plantae | Fabaceae | Rhynchosia pyramidalis | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Sophora secundiflora | Ref. |
Plantae | Fabaceae | Sophora subprostrata | Ref. |
Plantae | Fabaceae | Strongylodon macrobotrys | Ref. |
Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
Plantae | Fabaceae | Teyleria koordersii | Ref. |
Plantae | Fabaceae | Thermopsis alterniflora | Ref. |
Plantae | Fabaceae | Thermopsis macrophylla | Ref. |
Plantae | Fabaceae | Thermopsis mollis | Ref. |
Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
Plantae | Fabaceae | Thermopsis villosa | Ref. |
Plantae | Fabaceae | Trifolium campestre | Ref. |
Plantae | Fabaceae | Trifolium globosum | Ref. |
Plantae | Fabaceae | Trifolium pannonicum | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Fabaceae | Trifolium riograndense | Ref. |
Plantae | Fabaceae | Trifolium spp. | Ref. |
Plantae | Fabaceae | Ulex boivinii | Ref. |
Plantae | Fabaceae | Ulex europaeus | Ref. |
Plantae | Fabaceae | Ulex gallii | Ref. |
Plantae | Fabaceae | Ulex genistoides | Ref. |
Plantae | Fabaceae | Ulex micranthus | Ref. |
Plantae | Fabaceae | Ulex minor | Ref. |
Plantae | Fabaceae | Ulex parviflorus | Ref. |
Plantae | Fabaceae | Vandasina retusa | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vigna angularis | Ref. |
Plantae | Fabaceae | Vigna mungo | Ref. |
Plantae | Fabaceae | Vigna radiata | Ref. |
Plantae | Fabaceae | Vigna subterranea | Ref. |
Plantae | Fabaceae | Wisteria brachybotrys | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hypericaceae | Hypericum scabrum | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Moraceae | Cudrania cochinchinensis | Ref. |
Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea | Ref. |
Plantae | Moraceae | Ficus cordata | Ref. |
Plantae | Moraceae | Ficus nymphaeifolia | Ref. |
Plantae | Moraceae | Ficus septica | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Poaceae | Zea mays L. | Ref. |
Plantae | Polygalaceae | Securidaca inappendiculata | Ref. |
Plantae | Rosaceae | Prunus cerasus | Ref. |
Plantae | Rosaceae | Prunus spp. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Fagelia bituminosa | Ref. |
- | - | Halotydeus destructor | Ref. |
- | - | Sarcolobus globosus | Ref. |
- | - | Slackia isoflavoniconvertens | Ref. |
- | - | Stemphilium sp. No. 644 | Ref. |
|
|
zoom in
Organism | Adenocarpus foliolosus | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Harborne,Phytochem.,8,(1969),1449
Markham,Phytochem.,7,(1968),791 |
---|
|