Name |
Coumarin |
Formula |
C9H6O2 |
Mw |
146.03677944 |
CAS RN |
91-64-5 |
C_ID |
C00002460
,
|
InChIKey |
ZYGHJZDHTFUPRJ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
SMILES |
c1ccc2c(c1)ccc(=O)o2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Araliaceae | Hydrocotyle sibthorpioides | Ref. |
Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Eupatorium odoratum | Ref. |
Plantae | Asteraceae | Liatris squarrosa | Ref. |
Plantae | Balsaminaceae | Impatiens siculifer | Ref. |
Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Scabiosa comosa | Ref. |
Plantae | Fabaceae | Amburana cearensis | Ref. |
Plantae | Fabaceae | Dalea tuberculata | Ref. |
Plantae | Fabaceae | Dipteryx odorata | Ref. |
Plantae | Fabaceae | Dipteryx punctata | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hypericaceae | Hypericum japonicum | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Lauraceae | Cinnamomum burmannii Nees ex BI | Ref. |
Plantae | Lauraceae | Cinnamomum cassia | Ref. |
Plantae | Lauraceae | Cinnamomum loureirii | Ref. |
Plantae | Moraceae | Ficus simplicissima | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Rutaceae | Clausena excavata | Ref. |
Plantae | Scrophulariaceae | Verbascum thapsus | Ref. |
Plantae | Zygophyllaceae | Tribulus terrestris | Ref. |
- | - | | Ref. |
- | - | Alyxia lucida | Ref. |
- | - | Torresea cearensis | Ref. |
|
|
zoom in
Organism | Thymus capitatus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|