Name |
Hygrine (+)-Hygrine D-(+)-Hygrine |
Formula |
C8H15NO |
Mw |
141.11536411 |
CAS RN |
496-49-1 |
C_ID |
C00002046
,
|
InChIKey |
ADKXZIOQKHHDNQ-SVGMAFHSNA-N |
InChICode |
InChI=1S/C8H15NO/c1-7(10)6-8-4-3-5-9(8)2/h8H,3-6H2,1-2H3/t8-/m0/s1 |
SMILES |
C1CN([C@@H](C1)CC(=O)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Convolvulaceae | Argyreia mollis | Ref. |
Plantae | Erythroxylaceae | Erythroxylum coca | Ref. |
Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Orchidaceae | Dendrobium chrysanthum | Ref. |
Plantae | Solanaceae | Atropa baetica | Ref. |
Plantae | Solanaceae | Hyoscyamus albus | Ref. |
Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
Plantae | Solanaceae | Hyoscyamus muticus | Ref. |
Plantae | Solanaceae | Nicandra physaloides | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Physalis alkekengi L. | Ref. |
Plantae | Solanaceae | Physalis peruviana | Ref. |
- | - | Corallia brachiata | Ref. |
- | - | Erythroxylon coca | Ref. |
|
|
zoom in
Organism | Erythroxylum novogranatense | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|