Name |
Cuscohygrine meso-Cuscohygrine |
Formula |
C13H24N2O |
Mw |
224.1888634 |
CAS RN |
454-14-8 |
C_ID |
C00002034
,
|
InChIKey |
ZEBIACKKLGVLFZ-TXEJJXNPNA-N |
InChICode |
InChI=1S/C13H24N2O/c1-14-7-3-5-11(14)9-13(16)10-12-6-4-8-15(12)2/h11-12H,3-10H2,1-2H3/t11-,12+ |
SMILES |
C1CN([C@H](C1)CC(=O)C[C@H]1N(CCC1)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Convolvulaceae | Argyreia mollis | Ref. |
Plantae | Convolvulaceae | Calystegia sepium | Ref. |
Plantae | Convolvulaceae | Convolvulus erinaceus | Ref. |
Plantae | Erythroxylaceae | Erythroxylum cataractarum | Ref. |
Plantae | Erythroxylaceae | Erythroxylum coca | Ref. |
Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
Plantae | Solanaceae | Atropa baetica | Ref. |
Plantae | Solanaceae | Atropa belladonna | Ref. |
Plantae | Solanaceae | Cyphomandra betacea | Ref. |
Plantae | Solanaceae | Cyphomandra betaceae | Ref. |
Plantae | Solanaceae | Datura ceratocaula | Ref. |
Plantae | Solanaceae | Datura spp. | Ref. |
Plantae | Solanaceae | Datura stramonium | Ref. |
Plantae | Solanaceae | Hyoscyamus albus | Ref. |
Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
Plantae | Solanaceae | Hyoscyamus muticus | Ref. |
Plantae | Solanaceae | Hyoscyamus niger | Ref. |
Plantae | Solanaceae | Mandragora autumnale | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Mandragora autunnale | Ref. |
Plantae | Solanaceae | Mandragora officinarum L. | Ref. |
Plantae | Solanaceae | Mandragora vernalis | Ref. |
Plantae | Solanaceae | Physalis alkekengi | Ref. |
Plantae | Solanaceae | Physalis peruviana | Ref. |
Plantae | Solanaceae | Scopolia spp. | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
- | - | Erythroxylon coca | Ref. |
- | - | Erythroxylon novogranatense | Ref. |
- | - | Salpichora origanifolia | Ref. |
|
|
zoom in
Organism | Hyoscyamus boveanus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|