Name |
Palmitoleic acid (Z)-Palmitoleic acid cis-Palmitoleic acid |
Formula |
C16H30O2 |
Mw |
254.2245802 |
CAS RN |
373-49-9 |
C_ID |
C00001234
,
|
InChIKey |
SECPZKHBENQXJG-FPLPWBNLSA-N |
InChICode |
InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7- |
SMILES |
CCCCCC/C=C\CCCCCCCC(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Plantae | Alliaceae | Allium hirtifolium | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Asphodelaceae | Aloe vera var.chinensis | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cruciferae | Isatis tinctoria | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
Plantae | Cucurbitaceae | Trichosanthes rosthornii | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Laminariaceae | Laminaria japonica | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Tilia cordata Mill. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Palmae | Elaeis guineensis | Ref. |
Plantae | Proteaceae | Macadamia ternifolia | Ref. |
Plantae | Rosaceae | Prunus armeniaca | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Calopyllum calaba | Ref. |
|
|
zoom in
Organism | Mucuna puriens | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|