Name |
Octanoic acid Caprylic acid n-Octanoic acid |
Formula |
C8H16O2 |
Mw |
144.11502975 |
CAS RN |
124-07-2 |
C_ID |
C00001231
,
|
InChIKey |
WWZKQHOCKIZLMA-UHFFFAOYSA-N |
InChICode |
InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10) |
SMILES |
C(=O)(O)CCCCCCC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Araliaceae | Panax quinquefolium | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Lythraceae | Cuphea painteri | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera Meerb. | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
- | - | Caffea sp. | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Poria cocos | Ref. |
- | - | Spongiporus leucomallellus (Murril) | Ref. |
|
|
zoom in
Organism | Bupleurum chinense | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
---|
|