Name |
Myristic acid Tetradecanoic acid n-Tetradecanoic acid |
Formula |
C14H28O2 |
Mw |
228.20893014 |
CAS RN |
544-63-8 |
C_ID |
C00001228
,
|
InChIKey |
TUNFSRHWOTWDNC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16) |
SMILES |
C(=O)(O)CCCCCCCCCCCCC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Plantae | Amaranthaceae | Celosia cristada | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Apiaceae | Angelica sinensis | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Conioselinum vaginatum | Ref. |
Plantae | Apiaceae | Notopterygium incisum | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Inula britannica var.chinensis | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Senecio vulgaris | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
Plantae | Cucurbitaceae | Trichosanthes rosthornii | Ref. |
Plantae | Euphorbiaceae | Croton tiglium | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Iridaceae | Iris flomentina | Ref. |
Plantae | Iridaceae | Iris florentina | Ref. |
Plantae | Jubulaceae | Frullania anomala | Ref. |
Plantae | Jubulaceae | Frullania incumbens | Ref. |
Plantae | Jubulaceae | Frullania lobulata | Ref. |
Plantae | Jubulaceae | Frullania probosciphora | Ref. |
Plantae | Jubulaceae | Frullania scandens | Ref. |
Plantae | Jubulaceae | Frullania spinifera | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Laminariaceae | Laminaria japonica | Ref. |
Plantae | Lauraceae | Litsea monopetala | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Tilia cordata Mill. | Ref. |
Plantae | Myristicaceae | Myristica fragrans | Ref. |
Plantae | Myristicaceae | Myristica moschata | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Palmae | Areca catechu | Ref. |
Plantae | Pandanaceae | Pandanus conoideus Lam | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Primulaceae | Primula ovalifolia | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
Plantae | Rosaceae | Prunus armeniaca | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera Meerb. | Ref. |
Plantae | Scrophulariaceae | Diascia cordata | Ref. |
Plantae | Scrophulariaceae | Diascia integerrima | Ref. |
Plantae | Scrophulariaceae | Diascia megathura | Ref. |
Plantae | Scrophulariaceae | Diascia purpurea | Ref. |
Plantae | Scrophulariaceae | Diascia vigilis | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
Plantae | Solanaceae | Hyoscyamus niger | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Bergera koenegii | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Hipppophae rhamnoides | Ref. |
- | - | Spongiporus leucomallellus (Murril) | Ref. |
|
|
zoom in
Organism | Celosia cristada | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chen, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 30, (1995), 526.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Calixto, et al., Planta Med, 69, (2003), 973.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|