Name |
Lauric acid Docosanoic acid n-Dodecanoic acid Dodecanoic acid |
Formula |
C12H24O2 |
Mw |
200.17763001 |
CAS RN |
143-07-7 |
C_ID |
C00001221
,
|
InChIKey |
POULHZVOKOAJMA-UHFFFAOYSA-N |
InChICode |
InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) |
SMILES |
C(=O)(O)CCCCCCCCCCC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
-- | Rhodomelaceae | Acantophora spicifera | Ref. |
Animalia | Hominidae | Homo sapiens (Skin) | Ref. |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Plantae | Amaranthaceae | Celosia cristada | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Asphodelaceae | Aloe vera var.chinensis | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Petasites hybridus | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
Plantae | Cucurbitaceae | Trichosanthes rosthornii | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Euphorbiaceae | Croton tiglium | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lauraceae | Neolitsea aciculata | Ref. |
Plantae | Lauraceae | Neolitsea sericea | Ref. |
Plantae | Lythraceae | Cuphea carthagenensis | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Palmae | Areca catechu | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Palmae | Elaeis guineensis | Ref. |
Plantae | Pinaceae | Cedrus libani | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Primulaceae | Primula ovalifolia | Ref. |
Plantae | Ranunculaceae | Nigella sativa L | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rubiaceae | Rubia wallichiana DECNE | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Ulmaceae | Holoptelea integrifolia | Ref. |
Plantae | Verbenaceae | Lantana camara | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
Plantae | Zygophyllaceae | Tribulus terrestris | Ref. |
- | - | Poria cocos | Ref. |
|
|
zoom in
Organism | Trifolium pratense | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|