Name |
D-Sucrose Sucrose (+)-Sucrose Saccharose |
Formula |
C12H22O11 |
Mw |
342.11621155 |
CAS RN |
57-50-1 |
C_ID |
C00001151
,
|
InChIKey |
CZMRCDWAGMRECN-PIZGLXSKNA-N |
InChICode |
InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5+,6+,7-,8-,9+,10+,11+,12-/m0/s1 |
SMILES |
OC[C@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@]1([C@@H]([C@H]([C@H](O1)CO)O)O)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Annonaceae | Xylopia poilanei | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Notopterygium incisum | Ref. |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Apiaceae | Pimpinella anisum L. | Ref. |
Plantae | Apiaceae | Saposhnikovia divaricata | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Apocynaceae | Marsdenia tomentosa | Ref. |
Plantae | Araliaceae | Acanthopanax senticosus | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Araliaceae | Panax quinquefolium | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Robinsonecio gerberifolius | Ref. |
Plantae | Asteraceae | Stevia rebaudiana | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllales | Beta vulgaris | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea | Ref. |
Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
Plantae | Crassulaceae | Rhodiola kirilowii | Ref. |
Plantae | Crassulaceae | Rhodiola rosea | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Isatis indigotica | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asperoides | Ref. |
Plantae | Fabaceae | Astragalus membranaceus | Ref. |
Plantae | Fabaceae | Astragalus mongholicus | Ref. |
Plantae | Fabaceae | Caragana microphylla | Ref. |
Plantae | Fabaceae | Derris oblonga | Ref. |
Plantae | Fabaceae | Genista corsica | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Labiatae | Ajuga reptans | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Liliaceae | Fritillaria unibracteata | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Gossypium hirsutum | Ref. |
Plantae | Melanthiaceae | Veratrum album | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Orchidaceae | Gastrodia elata | Ref. |
Plantae | Paeoniaceae | Paeonia peregrina | Ref. |
Plantae | Phyllanthaceae | Phyllanthus sellowianus | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Plantaginaceae | Plantago asiatica | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Saccharum officinarum | Ref. |
Plantae | Poaceae | Sorghum bicolor | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Polypodiaceae | Pyrrosia lingua | Ref. |
Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
Plantae | Polytrichaceae | Polytrichum commune | Ref. |
Plantae | Pteridaceae | Pteris multifida | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rubiaceae | Coffea arabica | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Rutaceae | Ruta graveolens | Ref. |
Plantae | Sapindaceae | Acer saccharum | Ref. |
Plantae | Sapotaceae | Sebertia acuminata | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Nicotiana sylvestris | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Symplocaceae | Symplocos caudata | Ref. |
Plantae | Zingiberaceae | Curcuma domestica | Ref. |
- | - | Caffea sp. | Ref. |
|
|
zoom in
Organism | Stevia rebaudiana | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|