Name |
Myricetin |
Formula |
C15H10O8 |
Mw |
318.0375673 |
CAS RN |
529-44-2 |
C_ID |
C00001071
,
|
InChIKey |
IKMDFBPHZNJCSN-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,16-20,22H |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1cc(c(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Anacardiaceae | Buchanania lanzan | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Rhus parviflora | Ref. |
Plantae | Anacardiaceae | Rhus wallichi | Ref. |
Plantae | Anacardiaceae | Semecarpus vitiensis | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Haplopappus canescens | Ref. |
Plantae | Betulaceae | Betula platyphylla var. japonica | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Crassulaceae | Sedum takesimense Nakai | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cunoniaceae | Davidsonia pruriens | Ref. |
Plantae | Cupressaceae | Thuja orientalis | Ref. |
Plantae | Dioscoreaceae | Dioscorea bulbifera | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
Plantae | Ericaceae | Rhododendron calophytum | Ref. |
Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
Plantae | Ericaceae | Rhododendron degronianum ssp. Heptamerum var. hondoense | Ref. |
Plantae | Ericaceae | Rhododendron fortunei | Ref. |
Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
Plantae | Ericaceae | Rhododendron micranthum | Ref. |
Plantae | Ericaceae | Rhododendron mucronatum | Ref. |
Plantae | Ericaceae | Rhododendron ponticum | Ref. |
Plantae | Ericaceae | Rhododendron praevernum | Ref. |
Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
Plantae | Ericaceae | Rhododendron ungernii | Ref. |
Plantae | Euphorbiaceae | Euphorbia palustris | Ref. |
Plantae | Euphorbiaceae | Euphorbia stepposa | Ref. |
Plantae | Fabaceae | Acacia aroma | Ref. |
Plantae | Fabaceae | Acacia cyanophylla | Ref. |
Plantae | Fabaceae | Acacia dealbata | Ref. |
Plantae | Fabaceae | Astragalus complanatus | Ref. |
Plantae | Fabaceae | Caragana frutex | Ref. |
Plantae | Fabaceae | Caragana jubata | Ref. |
Plantae | Fabaceae | Ceratonia siliqua | Ref. |
Plantae | Fabaceae | Hypocalyptus sophoroides | Ref. |
Plantae | Fabaceae | Intsia bijuga | Ref. |
Plantae | Fabaceae | Intsia palembanica | Ref. |
Plantae | Fabaceae | Lathyrus aphaca | Ref. |
Plantae | Fabaceae | Lathyrus spp. | Ref. |
Plantae | Fabaceae | Lotus maritimus | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago blancheana | Ref. |
Plantae | Fabaceae | Medicago cancellata | Ref. |
Plantae | Fabaceae | Medicago cretacea | Ref. |
Plantae | Fabaceae | Medicago doliata | Ref. |
Plantae | Fabaceae | Medicago falcata | Ref. |
Plantae | Fabaceae | Medicago glomerata | Ref. |
Plantae | Fabaceae | Medicago hybrida | Ref. |
Plantae | Fabaceae | Medicago intertexta | Ref. |
Plantae | Fabaceae | Medicago laciniata | Ref. |
Plantae | Fabaceae | Medicago lupulina | Ref. |
Plantae | Fabaceae | Medicago monantha | Ref. |
Plantae | Fabaceae | Medicago monspeliaca | Ref. |
Plantae | Fabaceae | Medicago murex | Ref. |
Plantae | Fabaceae | Medicago orbicularis | Ref. |
Plantae | Fabaceae | Medicago polyceratia | Ref. |
Plantae | Fabaceae | Medicago polymorpha | Ref. |
Plantae | Fabaceae | Medicago radiata | Ref. |
Plantae | Fabaceae | Medicago rotata | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago scutellata | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Melilotus italica | Ref. |
Plantae | Fabaceae | Melilotus messanensis | Ref. |
Plantae | Fabaceae | Melilotus officinalis | Ref. |
Plantae | Fabaceae | Melilotus sulcatus | Ref. |
Plantae | Fabaceae | Melilotus wolgicus | Ref. |
Plantae | Fabaceae | Millettia racemosa | Ref. |
Plantae | Fabaceae | Peltophorum africanum | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Prosopis reptans | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Fabaceae | Trigonella balansae | Ref. |
Plantae | Fabaceae | Trigonella calliceras | Ref. |
Plantae | Fabaceae | Trigonella cretica | Ref. |
Plantae | Fabaceae | Trigonella geminiflora | Ref. |
Plantae | Fabaceae | Vicia bithynica | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vicia johannis | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Fumariaceae | Fumaria officinalis | Ref. |
Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
Plantae | Fumariaceae | Fumaria vaillantii | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hydrocharitaceae | Halophila johnsonii | Ref. |
Plantae | Hypericaceae | Hypericum hirsutum | Ref. |
Plantae | Hypericaceae | Hypericum scabrum | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Labiatae | Salvia hispanica | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Lauraceae | Machilus bombycina | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Abelmoschus manihot | Ref. |
Plantae | Malvaceae | Hibiscus sabdariffa L. | Ref. |
Plantae | Meliaceae | Soymida febrifuga | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Musaceae | Musa acuminata | Ref. |
Plantae | Myricaceae | Myrica cerifera | Ref. |
Plantae | Myricaceae | Myrica nagi | Ref. |
Plantae | Myricaceae | Myrica rubra | Ref. |
Plantae | Myrsinaceae | Ardisia colorata | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Eugenia jambolana | Ref. |
Plantae | Myrtaceae | Kunzea ericoides | Ref. |
Plantae | Myrtaceae | Pimenta dioica | Ref. |
Plantae | Myrtaceae | Plinia pinnata | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Myrtaceae | Syzygium cumini | Ref. |
Plantae | Myrtaceae | Syzygium samarangense | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Nymphaeaceae | Nymphaea lotus | Ref. |
Plantae | Nymphaeaceae | Nymphaea odorata | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Phyllanthaceae | Bridelia ferruginea | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Pseudolarix amabilis | Ref. |
Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
Plantae | Polygonaceae | Polygonum amphibium | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Polygonaceae | Polygonum bistorta | Ref. |
Plantae | Polygonaceae | Polygonum convolvulus | Ref. |
Plantae | Polygonaceae | Polygonum equiseiforme | Ref. |
Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
Plantae | Polygonaceae | Polygonum lapathifolium | Ref. |
Plantae | Polygonaceae | Polygonum mite | Ref. |
Plantae | Polygonaceae | Polygonum persicaria | Ref. |
Plantae | Polygonaceae | Polygonum viscosum | Ref. |
Plantae | Polygonaceae | Rumex thyrsiflorus | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rhamnaceae | Hovenia dulcis | Ref. |
Plantae | Rosaceae | Rosa damascene | Ref. |
Plantae | Sapindaceae | Xanthoceras sorbifolia | Ref. |
Plantae | Sapotaceae | Diploknema butyracea | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Taxaceae | Taxus buccata | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus cuspidata | Ref. |
Plantae | Vitaceae | Ampelopsis grossedentata | Ref. |
- | - | Morella rubra | Ref. |
- | - | Oxycoccus quadripetalis | Ref. |
|
|
zoom in
Organism | Trifolium pratense | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|