Name |
Sakuranetin 5,4'-Dihydroxy-7-methoxyflavanone Naringenin 7-O-methyl ether |
Formula |
C16H14O5 |
Mw |
286.08412356 |
CAS RN |
2957-21-3 |
C_ID |
C00000999
,
|
InChIKey |
DJOJDHGQRNZXQQ-YQTOOIBONA-N |
InChICode |
InChI=1S/C16H14O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1ccc(cc1)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ageratina havanensis | Ref. |
Plantae | Asteraceae | Artemisia campestris | Ref. |
Plantae | Asteraceae | Baccharis spp. | Ref. |
Plantae | Asteraceae | Polymnia fruticosa | Ref. |
Plantae | Betulaceae | Betula spp. | Ref. |
Plantae | Boraginaceae | Heliotropium filifolium | Ref. |
Plantae | Boraginaceae | Heliotropium glutinosum | Ref. |
Plantae | Celastraceae | Microtropis japonica | Ref. |
Plantae | Combretaceae | Terminalia fagifolia | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Mimosa hostilis | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Juglandaceae | Juglans spp. | Ref. |
Plantae | Labiatae | Origanum calcaratum | Ref. |
Plantae | Labiatae | Origanum dictamnus | Ref. |
Plantae | Labiatae | Origanum floribundum | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum microphyllum | Ref. |
Plantae | Labiatae | Origanum onites | Ref. |
Plantae | Labiatae | Origanum syriacum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Glandulosum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Hirtum | Ref. |
Plantae | Piperaceae | Piper crassinervium Kunth | Ref. |
Plantae | Piperaceae | Piper lhotzkyanum | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus cerasus | Ref. |
Plantae | Rosaceae | Prunus spp. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Xanthorrhoeaceae | Xanthorrhoea hastilis | Ref. |
Plantae | Zingiberaceae | Boesenbergia rotunda (L.) Mansf.Kulturpfl. | Ref. |
|
|
zoom in
Organism | Ageratina havanensis | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|