Name |
Hesperidin |
Formula |
C28H34O15 |
Mw |
610.18977042 |
CAS RN |
520-26-3 |
C_ID |
C00000970
,
|
InChIKey |
QUQPHWDTPGMPEX-IGGWMNTDNA-N |
InChICode |
InChI=1S/C28H34O15/c1-10-21(32)23(34)25(36)27(40-10)39-9-19-22(33)24(35)26(37)28(43-19)41-12-6-14(30)20-15(31)8-17(42-18(20)7-12)11-3-4-16(38-2)13(29)5-11/h3-7,10,17,19,21-30,32-37H,8-9H2,1-2H3/t10-,17-,19-,21-,22+,23+,24-,25-,26+,27+,28+/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1cc(c(cc1)OC)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO[C@@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)C)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Asteraceae | Baccharis magellanica | Ref. |
Plantae | Asteraceae | Vernonia spp. | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Fagaceae | Castanea sativa | Ref. |
Plantae | Labiatae | Hyssopus spp. | Ref. |
Plantae | Labiatae | Mentha longifolia | Ref. |
Plantae | Labiatae | Mentha spp. | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Moraceae | Ficus beecheyana | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Rutaceae | Citrus aurantium L. var. amara | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus natsudaidai | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Citrus sudachi | Ref. |
Plantae | Rutaceae | Citrus unshiu Markovich | Ref. |
Plantae | Rutaceae | Esenbeckia yaxhoob Lundell | Ref. |
Plantae | Rutaceae | Flindersia laevicarpa C.T.White et Francis. | Ref. |
Plantae | Rutaceae | Poncirus trifoliata | Ref. |
Plantae | Rutaceae | Zanthoxylum dipetalum | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Turneraceae | Turnera ulmifolia | Ref. |
Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
Plantae | Verbenaceae | Verbena hybrida | Ref. |
- | - | Rutaceae | Ref. |
|
|
zoom in
Organism | Vernonia spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 410,Flavanones and dihydroflavonols
Mager,Zisch.Physiol.Chem.,274,(1942),109 |
---|
|