Name |
Eriodictyol (+)-Eriodictyol (+)-Eriodictol |
Formula |
C15H12O6 |
Mw |
288.06338812 |
CAS RN |
552-58-9 |
C_ID |
C00000960
,
|
InChIKey |
SBHXYTNGIZCORC-UGPWUYPHNA-N |
InChICode |
InChI=1S/C15H12O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,13,16-19H,6H2/t13-/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1cc(c(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Asteraceae | Anthemis altissima | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
Plantae | Asteraceae | Eupatorium subhastatum | Ref. |
Plantae | Asteraceae | Filifolium sibiricum | Ref. |
Plantae | Asteraceae | Helichrysum bracteatum (Vent.)Andr. | Ref. |
Plantae | Asteraceae | Onopordum acanthium | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Tessaria dodoneifolia | Ref. |
Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia conrauana | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia livingstonei | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
Plantae | Ericaceae | Lyonia ovalifolia | Ref. |
Plantae | Erythroxylaceae | Erythroxylum australe | Ref. |
Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
Plantae | Fabaceae | Acacia pennatula | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Bauhinia guianensis | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dipteryx odorata | Ref. |
Plantae | Fabaceae | Eysenhardtia subcoriacea Pennell | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Spatholobus suberectus Dunn | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon californicum | Ref. |
Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
Plantae | Labiatae | Mentha longifolia | Ref. |
Plantae | Labiatae | Origanum dictamnus | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Phlomis nissolii | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
Plantae | Rosaceae | Prunus armygdalus | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus unshiu Markovich | Ref. |
Plantae | Salicaceae | Salix purpurea | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
- | - | Saracha punctata | Ref. |
|
|
zoom in
Organism | Eupatorium subhastatum | Reference | Calixto, et al., Planta Med, 70, (2004), 93.
ZHANG, et al., Chem Pharm Bull, 50, (2002), 841.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
---|
|