Name |
5,7,3',4'-Tetrahydroxyflavone Luteolin |
Formula |
C15H10O6 |
Mw |
286.04773805 |
CAS RN |
491-70-3 |
C_ID |
C00000674
,
|
InChIKey |
IQPNAANSBPBGFQ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1cc(c(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera fulvotomentosa | Ref. |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Annonaceae | Artabotrys uncinatus | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Araceae | Colocasia escultenta | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia minor | Ref. |
Plantae | Asteraceae | Bidens tripartita | Ref. |
Plantae | Asteraceae | Blumea balsamifera | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Chrysanthemum cineraiaefolium | Ref. |
Plantae | Asteraceae | Chrysanthemum indicum | Ref. |
Plantae | Asteraceae | Chrysanthemum morifolium | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Inula japonica | Ref. |
Plantae | Asteraceae | Lactuca indica | Ref. |
Plantae | Asteraceae | Leontodon autumnalis | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Picris cyanocarpa | Ref. |
Plantae | Asteraceae | Picris kamtschatica | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Saussurea medusa | Ref. |
Plantae | Asteraceae | Stevia rebaudiana | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Asteraceae | Vernonia pectoralis | Ref. |
Plantae | Berberidaceae | Epimedium acuminatum | Ref. |
Plantae | Berberidaceae | Epimedium brevicornum | Ref. |
Plantae | Berberidaceae | Epimedium dolichostemen | Ref. |
Plantae | Berberidaceae | Epimedium fargesii | Ref. |
Plantae | Berberidaceae | Epimedium franchetii | Ref. |
Plantae | Berberidaceae | Epimedium koreanum | Ref. |
Plantae | Berberidaceae | Epimedium leishanense | Ref. |
Plantae | Berberidaceae | Epimedium leptorrhizum | Ref. |
Plantae | Berberidaceae | Epimedium membranaceum | Ref. |
Plantae | Berberidaceae | Epimedium myrianthum | Ref. |
Plantae | Berberidaceae | Epimedium pubescens | Ref. |
Plantae | Berberidaceae | Epimedium sagittatum | Ref. |
Plantae | Berberidaceae | Epimedium zhenbaense | Ref. |
Plantae | Berberidaceae | Epimedium zhushanense | Ref. |
Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
Plantae | Buddlejaceae | Buddleja officinalis | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis clematidea | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen OLIV. | Ref. |
Plantae | Cannabaceae | Cannabis indica | Ref. |
Plantae | Cannabaceae | Cannabis sativa | Ref. |
Plantae | Capparaceae | Capparis himalayensis | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Caryophyllaceae | Lychnis flos-cuculi L. | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xipshuanbannaensis | Ref. |
Plantae | Commelinaceae | Commelina communis | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Convolvulaceae | Merremia tridentata | Ref. |
Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
Plantae | Crassulaceae | Rhodiola rosea | Ref. |
Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
Plantae | Crassulaceae | Sedum sarmentosum | Ref. |
Plantae | Crassulaceae | Sedum takesimense Nakai | Ref. |
Plantae | Crassulaceae | Sinocrassula indica | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Eriocaulaceae | Leiothrix curvifolia | Ref. |
Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
Plantae | Fabaceae | Abrus precatorius | Ref. |
Plantae | Fabaceae | Acacia aroma | Ref. |
Plantae | Fabaceae | Acacia caven | Ref. |
Plantae | Fabaceae | Acacia furcatispina | Ref. |
Plantae | Fabaceae | Acacia leucophloea | Ref. |
Plantae | Fabaceae | Acacia praecox | Ref. |
Plantae | Fabaceae | Albizia chinensis | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Astragalus coluteocarpus | Ref. |
Plantae | Fabaceae | Astragalus eremophilus | Ref. |
Plantae | Fabaceae | Astragalus kabadianus | Ref. |
Plantae | Fabaceae | Astragalus quisqualis | Ref. |
Plantae | Fabaceae | Baptisia arachnifera | Ref. |
Plantae | Fabaceae | Baptisia australis | Ref. |
Plantae | Fabaceae | Baptisia bracteata | Ref. |
Plantae | Fabaceae | Baptisia calycosa | Ref. |
Plantae | Fabaceae | Baptisia cinerea | Ref. |
Plantae | Fabaceae | Baptisia lanceolata | Ref. |
Plantae | Fabaceae | Baptisia lecontei | Ref. |
Plantae | Fabaceae | Baptisia megacarpa | Ref. |
Plantae | Fabaceae | Baptisia nuttalliana | Ref. |
Plantae | Fabaceae | Baptisia perfoliata | Ref. |
Plantae | Fabaceae | Baptisia simplicifolia | Ref. |
Plantae | Fabaceae | Baptisia sphaerocarpa | Ref. |
Plantae | Fabaceae | Baptisia tinctoria | Ref. |
Plantae | Fabaceae | Cadia purpurea | Ref. |
Plantae | Fabaceae | Caesalpinia gilliesii | Ref. |
Plantae | Fabaceae | Cassia absu | Ref. |
Plantae | Fabaceae | Cassia spectabilis | Ref. |
Plantae | Fabaceae | Chamaecrista absus | Ref. |
Plantae | Fabaceae | Chamaecrista mimosoides | Ref. |
Plantae | Fabaceae | Crotalaria pallida | Ref. |
Plantae | Fabaceae | Cytisophyllum sessilifolium | Ref. |
Plantae | Fabaceae | Cytisus eriocarpus | Ref. |
Plantae | Fabaceae | Cytisus hirsutus | Ref. |
Plantae | Fabaceae | Cytisus proliferus | Ref. |
Plantae | Fabaceae | Cytisus striatus | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Erythrophleum suaveolens | Ref. |
Plantae | Fabaceae | Galega officinalis | Ref. |
Plantae | Fabaceae | Genista acanthoclada | Ref. |
Plantae | Fabaceae | Genista carpetana | Ref. |
Plantae | Fabaceae | Genista corsica | Ref. |
Plantae | Fabaceae | Genista depressa | Ref. |
Plantae | Fabaceae | Genista ferox | Ref. |
Plantae | Fabaceae | Genista januensis | Ref. |
Plantae | Fabaceae | Genista lydia | Ref. |
Plantae | Fabaceae | Genista morisii | Ref. |
Plantae | Fabaceae | Genista nissana | Ref. |
Plantae | Fabaceae | Genista obtusiramea | Ref. |
Plantae | Fabaceae | Genista pilosa | Ref. |
Plantae | Fabaceae | Genista sagittalis | Ref. |
Plantae | Fabaceae | Genista scorpius | Ref. |
Plantae | Fabaceae | Genista spartioides | Ref. |
Plantae | Fabaceae | Genista stenopetala | Ref. |
Plantae | Fabaceae | Genista teretifolia | Ref. |
Plantae | Fabaceae | Genista tinctoria | Ref. |
Plantae | Fabaceae | Genista triacanthos | Ref. |
Plantae | Fabaceae | Genista versicolor | Ref. |
Plantae | Fabaceae | Gleditsia australis | Ref. |
Plantae | Fabaceae | Gleditsia triacanthos | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Gonocytisus angulatus | Ref. |
Plantae | Fabaceae | Hesperolaburnum platycarpum | Ref. |
Plantae | Fabaceae | Kummerowia striata | Ref. |
Plantae | Fabaceae | Lathyrus pratensis | Ref. |
Plantae | Fabaceae | Lens culinaris | Ref. |
Plantae | Fabaceae | Lupinus arboreus | Ref. |
Plantae | Fabaceae | Lupinus polyphyllus | Ref. |
Plantae | Fabaceae | Lupinus sericeus | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago coronata | Ref. |
Plantae | Fabaceae | Medicago laciniata | Ref. |
Plantae | Fabaceae | Medicago littoralis | Ref. |
Plantae | Fabaceae | Medicago marina | Ref. |
Plantae | Fabaceae | Medicago minima | Ref. |
Plantae | Fabaceae | Medicago orbicularis | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Ononis spinosa | Ref. |
Plantae | Fabaceae | Parkinsonia aculeata | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Podocytisus caramanicus | Ref. |
Plantae | Fabaceae | Prosopis affinis | Ref. |
Plantae | Fabaceae | Prosopis alba | Ref. |
Plantae | Fabaceae | Prosopis argentina | Ref. |
Plantae | Fabaceae | Prosopis chilensis | Ref. |
Plantae | Fabaceae | Prosopis flexuosa | Ref. |
Plantae | Fabaceae | Prosopis glandulosa | Ref. |
Plantae | Fabaceae | Prosopis juliflora | Ref. |
Plantae | Fabaceae | Prosopis laevigata | Ref. |
Plantae | Fabaceae | Prosopis nigra | Ref. |
Plantae | Fabaceae | Prosopis reptans | Ref. |
Plantae | Fabaceae | Prosopis ruscifolia | Ref. |
Plantae | Fabaceae | Prosopis sericantha | Ref. |
Plantae | Fabaceae | Prosopis strombulifera | Ref. |
Plantae | Fabaceae | Prosopis velutina | Ref. |
Plantae | Fabaceae | Prosopis vinalillo | Ref. |
Plantae | Fabaceae | Rhynchosia suaveolens | Ref. |
Plantae | Fabaceae | Senna didymobotrya | Ref. |
Plantae | Fabaceae | Senna siamea | Ref. |
Plantae | Fabaceae | Sophora microphylla | Ref. |
Plantae | Fabaceae | Sophora prostrata | Ref. |
Plantae | Fabaceae | Thermopsis dolichocarpa | Ref. |
Plantae | Fabaceae | Thermopsis macrophylla | Ref. |
Plantae | Fabaceae | Thermopsis mollis | Ref. |
Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
Plantae | Fabaceae | Thermopsis villosa | Ref. |
Plantae | Fabaceae | Trifolium pannonicum | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Fabaceae | Trifolium subterraneum | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Vicia acutifolia | Ref. |
Plantae | Fabaceae | Vicia americana | Ref. |
Plantae | Fabaceae | Vicia articulata | Ref. |
Plantae | Fabaceae | Vicia balansae | Ref. |
Plantae | Fabaceae | Vicia benghalensis | Ref. |
Plantae | Fabaceae | Vicia ciceroidea | Ref. |
Plantae | Fabaceae | Vicia cracca | Ref. |
Plantae | Fabaceae | Vicia dumetorum | Ref. |
Plantae | Fabaceae | Vicia epetiolaris | Ref. |
Plantae | Fabaceae | Vicia ervilia | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vicia floridana | Ref. |
Plantae | Fabaceae | Vicia glauca | Ref. |
Plantae | Fabaceae | Vicia hirsuta | Ref. |
Plantae | Fabaceae | Vicia michauxii | Ref. |
Plantae | Fabaceae | Vicia minutiflora | Ref. |
Plantae | Fabaceae | Vicia mollis | Ref. |
Plantae | Fabaceae | Vicia monantha | Ref. |
Plantae | Fabaceae | Vicia multijuga | Ref. |
Plantae | Fabaceae | Vicia ochroleuca | Ref. |
Plantae | Fabaceae | Vicia onobrychioides | Ref. |
Plantae | Fabaceae | Vicia pannonica | Ref. |
Plantae | Fabaceae | Vicia pinetorum | Ref. |
Plantae | Fabaceae | Vicia sicula | Ref. |
Plantae | Fabaceae | Vicia splendens | Ref. |
Plantae | Fabaceae | Vicia sylvatica | Ref. |
Plantae | Fabaceae | Vicia tenuifolia | Ref. |
Plantae | Fabaceae | Vigna trilobata | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Fumariaceae | Fumaria officinalis | Ref. |
Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
Plantae | Fumariaceae | Fumaria vaillantii | Ref. |
Plantae | Gentianaceae | Gentiana arisanensis | Ref. |
Plantae | Gentianaceae | Gentianopsis paludosa | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Haemodoraceae | Anigozanthos pulcherrimus | Ref. |
Plantae | Haemodoraceae | Anigozanthos rufus | Ref. |
Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
Plantae | Hydrocharitaceae | Halophila johnsonii | Ref. |
Plantae | Juncaceae | Juncus effusus | Ref. |
Plantae | Juncaceae | Luzula multiflora | Ref. |
Plantae | Labiatae | Ajuga decumbens | Ref. |
Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
Plantae | Labiatae | Elsholtzia rugulosa Hemsl. | Ref. |
Plantae | Labiatae | Melissa officinalis | Ref. |
Plantae | Labiatae | Microtoena prainiana | Ref. |
Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton | Ref. |
Plantae | Labiatae | Ocimum basilicum L. | Ref. |
Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
Plantae | Labiatae | Origanum dictamnus | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum majoricum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Prunella vulgaris | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia aegyptiaca | Ref. |
Plantae | Labiatae | Salvia albimaculata | Ref. |
Plantae | Labiatae | Salvia dorrii | Ref. |
Plantae | Labiatae | Salvia horminum | Ref. |
Plantae | Labiatae | Salvia hypoleuca | Ref. |
Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
Plantae | Labiatae | Salvia lavandulifolia | Ref. |
Plantae | Labiatae | Salvia limbata | Ref. |
Plantae | Labiatae | Salvia nutans | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia palaestina | Ref. |
Plantae | Labiatae | Salvia pedicellata | Ref. |
Plantae | Labiatae | Salvia pinnata | Ref. |
Plantae | Labiatae | Salvia pratensis | Ref. |
Plantae | Labiatae | Salvia staminea | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Schizonepeta tenuifolia | Ref. |
Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
Plantae | Labiatae | Thymus comosus | Ref. |
Plantae | Labiatae | Thymus numidicus | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Lauraceae | Machilus philippinensis | Ref. |
Plantae | Linaceae | Linum austriacum subsp.glaucescens | Ref. |
Plantae | Linaceae | Linum hirsutum subsp.anatolicum | Ref. |
Plantae | Linaceae | Linum tenuifolium | Ref. |
Plantae | Lythraceae | Lawsonia alba | Ref. |
Plantae | Lythraceae | Lawsonia inermis | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Lythraceae | Sonneratia caseolaris | Ref. |
Plantae | Malvaceae | Sida galheirensis | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Moraceae | Broussonetia papyrifera | Ref. |
Plantae | Moraceae | Ficus cordata | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myoporaceae | Myoporum bontioides | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Oleaceae | Syringa afghanica | Ref. |
Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Plantaginaceae | Antirrhinum majus | Ref. |
Plantae | Plantaginaceae | Bacopa monniera | Ref. |
Plantae | Plantaginaceae | Plantago argentea | Ref. |
Plantae | Plantaginaceae | Plantago holosteum | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Plantago maritima | Ref. |
Plantae | Plantaginaceae | Veronica chamaedrys | Ref. |
Plantae | Plantaginaceae | Veronica officinalis | Ref. |
Plantae | Plantaginaceae | Veronica orchidea | Ref. |
Plantae | Plantaginaceae | Veronica teucrium | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
Plantae | Polygonaceae | Polygonum amphibium | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Polygonaceae | Polygonum bistorta | Ref. |
Plantae | Polygonaceae | Polygonum convolvulus | Ref. |
Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
Plantae | Polygonaceae | Polygonum lapathifolium | Ref. |
Plantae | Polygonaceae | Polygonum mite | Ref. |
Plantae | Polygonaceae | Polygonum persicaria | Ref. |
Plantae | Polygonaceae | Rumex dentatus | Ref. |
Plantae | Polygonaceae | Rumex vesicarius | Ref. |
Plantae | Pteridaceae | Notholaena californica | Ref. |
Plantae | Ranunculaceae | Aquilegia ecalcarata | Ref. |
Plantae | Resedaceae | Reseda luteola | Ref. |
Plantae | Resedaceae | Reseda muricata C.Presl. | Ref. |
Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Salicaceae | Salix babylonica | Ref. |
Plantae | Salicaceae | Salix matsudana | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Scrophulariaceae | Verbascum sinaiticum | Ref. |
Plantae | Smilacaceae | Smilax riparia | Ref. |
Plantae | Solanaceae | Capsicum annum L. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Petunia hybrida | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Thymelaeaceae | Daphne genkwa | Ref. |
Plantae | Turneraceae | Turnera diffusa | Ref. |
Plantae | Turneraceae | Turnera subulata | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana amurensis | Ref. |
Plantae | Verbenaceae | Lippia sidoides | Ref. |
Plantae | Verbenaceae | Verbena officinalis | Ref. |
Plantae | Zosteraceae | Phyllospadix iwatensis | Ref. |
Plantae | Zosteraceae | Phyllospadix japonicus | Ref. |
- | - | Galla chinensis | Ref. |
- | - | Paraburkholderia phymatum | Ref. |
- | - | Pentemon gentianoides HBK | Ref. |
|
|
zoom in
Organism | Chrysanthemum morifolium | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Li, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 31, (1996), 849.
Ling, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 232.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Chen, et al., Journal of Natural Products, 64, (2001), 85.
MATSUDA, et al., Chem Pharm Bull, 50, (2002), 972.
Calixto, et al., Planta Med, 69, (2003), 973.
Calixto, et al., Planta Med, 70, (2004), 93.
XIE, et al., Chem Pharm Bull, 53, (2005), 1416.
Hou, et al., Journal of Natural Products, 65, (2002), 1759.
Hou, et al., Journal of Natural Products, 66, (2003), 625.
Li, et al., Journal of Natural Products, 67, (2004), 978.
Topcu, et al., Planta Med, 69, (2003), 464.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Peng, et al., Chinese J of Pharm Analysis, 30, (2010), 633 |
---|
|