Name |
1,8-Cineol 1,8-Cineole Eucalyptol Cineol Cineole |
Formula |
C10H18O |
Mw |
154.1357652 |
CAS RN |
470-82-6 |
C_ID |
C00000136
,
|
InChIKey |
WEEGYLXZBRQIMU-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H18O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h8H,4-7H2,1-3H3/t8-,10+ |
SMILES |
C1C[C@H]2CC[C@@]1(OC2(C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Fungi | Nectriaceae | Fusarium culmorum | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Cananga odorata | Ref. |
Plantae | Annonaceae | Xylopia aethiopica | Ref. |
Plantae | Annonaceae | Xylopia cayennensis | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Apiaceae | Cuminum cyminum L. | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apocynaceae | Tabernaemontana catharinensis | Ref. |
Plantae | Aristolochiaceae | Asarum heterotropoides var.mandsuricum | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii | Ref. |
Plantae | Asteraceae | Achillea santolinoids | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Ajania fruticulosa | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia anethoides | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia californica | Ref. |
Plantae | Asteraceae | Artemisia cana ssp.viscidula | Ref. |
Plantae | Asteraceae | Artemisia maritima var. stechmannia | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Centaurea orientalis | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Chrysanthemum boreale | Ref. |
Plantae | Asteraceae | Conyza newii | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Helichrysum italicum | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tanacetum vulgare | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus | Ref. |
Plantae | Burseraceae | Canarium album | Ref. |
Plantae | Burseraceae | Commiphora mukul | Ref. |
Plantae | Calycanthaceae | Calycanthus floridus | Ref. |
Plantae | Canellaceae | Canella winterana | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cruciferae | Hesperis matronalis | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
Plantae | Euphorbiaceae | Croton lechleri Mull.Arg. | Ref. |
Plantae | Fabaceae | Amorpha fruticosa | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Fagaceae | Quercus coccifera | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Illiciaceae | Illicium anisatum | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Lavandula angustifolia | Ref. |
Plantae | Labiatae | Lavandula dentata | Ref. |
Plantae | Labiatae | Lavandula stoechas | Ref. |
Plantae | Labiatae | Mentha arvensis L. | Ref. |
Plantae | Labiatae | Mentha piperita L. | Ref. |
Plantae | Labiatae | Mentha pulegium L. | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia hydrangea | Ref. |
Plantae | Labiatae | Salvia leucophylla | Ref. |
Plantae | Labiatae | Salvia mirzayanii | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia santolinifolia | Ref. |
Plantae | Labiatae | Tetradenia riparia | Ref. |
Plantae | Labiatae | Thymus eriocalyx | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Labiatae | Thymus X-porlock | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Lamiaceae | Calamintha nepeta | Ref. |
Plantae | Lamiaceae | Coridothymus capitatus | Ref. |
Plantae | Lamiaceae | Rabdosia rubescens | Ref. |
Plantae | Lauraceae | Cinnamomum augustifolium | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum camphorata | Ref. |
Plantae | Lauraceae | Cinnamomum fragrans | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lauraceae | Lindera neesiana | Ref. |
Plantae | Lauraceae | Litsea pungens | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Myrtaceae | Eucalyptus alba | Ref. |
Plantae | Myrtaceae | Eucalyptus bicostata | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis | Ref. |
Plantae | Myrtaceae | Eucalyptus cinerea | Ref. |
Plantae | Myrtaceae | Eucalyptus cineria | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodara | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora | Ref. |
Plantae | Myrtaceae | Eucalyptus deglupta | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Eucalyptus grandis | Ref. |
Plantae | Myrtaceae | Eucalyptus leucoxylon | Ref. |
Plantae | Myrtaceae | Eucalyptus macathurii | Ref. |
Plantae | Myrtaceae | Eucalyptus mackliana | Ref. |
Plantae | Myrtaceae | Eucalyptus maideni | Ref. |
Plantae | Myrtaceae | Eucalyptus maidenii | Ref. |
Plantae | Myrtaceae | Eucalyptus microcorys | Ref. |
Plantae | Myrtaceae | Eucalyptus nitens | Ref. |
Plantae | Myrtaceae | Eucalyptus pellita | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Eucalyptus resinifera | Ref. |
Plantae | Myrtaceae | Eucalyptus robusta | Ref. |
Plantae | Myrtaceae | Eucalyptus saligna | Ref. |
Plantae | Myrtaceae | Eucalyptus sideroxylon | Ref. |
Plantae | Myrtaceae | Eucalyptus smithii | Ref. |
Plantae | Myrtaceae | Eucalyptus tereticornis | Ref. |
Plantae | Myrtaceae | Eucalyptus torelliana | Ref. |
Plantae | Myrtaceae | Eucalyptus viminalis | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendron | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Rutaceae | Zanthoxylum bungeanum | Ref. |
Plantae | Rutaceae | Zanthoxylum decaryi | Ref. |
Plantae | Saururaceae | Anemopsis californica | Ref. |
Plantae | Solanaceae | Nicotiana alata | Ref. |
Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
Plantae | Solanaceae | Nicotiana langsdorffii | Ref. |
Plantae | Solanaceae | Nicotiana mutabilis | Ref. |
Plantae | Turneraceae | Turnera diffusa | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Verbenaceae | Lippia javanica | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Verbenaceae | Verbena officinalis | Ref. |
Plantae | Zingiberaceae | Alpinia officinarum | Ref. |
Plantae | Zingiberaceae | Alpinia zerumbet | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica | Ref. |
Plantae | Zingiberaceae | Curcuma kwangsiensis | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza | Ref. |
Plantae | Zingiberaceae | Curcuma zedoaria | Ref. |
Plantae | Zingiberaceae | Hedychium coronarium | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Csitus ladaniferus | Ref. |
|
|
zoom in
Organism | Origanum vulgare | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|